Pelirine

Pelirine

Inquiry
Catalog Number ACM30435268
CAS Number 30435-26-8
Structure
Synonyms 10-Methoxyepiaffinine
Molecular Weight 354.4
InChI InChI=1S/C21H26N2O3/c1-4-12-10-23(2)19-8-16-15-7-13(26-3)5-6-18(15)22-21(16)20(25)9-14(12)17(19)11-24/h4-7,14,17,19,22,24H,8-11H2,1-3H3
InChI Key MFJKLERWGHCFMH-UHFFFAOYSA-N
Melting Point 130-131 °C
Purity 95%+
Complexity 578
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 354.1943427
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 2
Monoisotopic Mass 354.1943427
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 65.6 Ų
Custom Q&A

What is the product name of the chemical compound with the CAS number 30435-26-8?

The product name is Pelirine.

What are some synonyms for Pelirine?

Some synonyms include 10-Methoxyepiaffinine and Vobasan-3-one, 17-hydroxy-10-methoxy-, (16R)-.

What is the molecular formula of Pelirine?

The molecular formula is C21H26N2O3.

What is the molecular weight of Pelirine?

The molecular weight is 354.44 g/mol.

What is the melting point of Pelirine?

The melting point is 130-131℃ (water methanol).

In what solvents is Pelirine soluble?

Pelirine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, and more.

How is Pelirine typically found in nature?

Pelirine is a constituent of the ethanolic extract of Rauwolfia perakensis.

What is the specific rotation of Pelirine in EtOH?

The specific rotation is [α]D -121° (c 1.0, EtOH).

What is the pKa of Pelirine?

The pKa is 14.70±0.10 (Predicted).

What is the predicted boiling point of Pelirine?

The predicted boiling point is 540.6±50.0 °C.

※ Please kindly note that our products are for research use only.