Penigequinolone A

Catalog Number	ACM180045914
CAS Number	180045-91-4
Structure
Description	Penigequinolone A is a chemical compound that belongs to the group of prenylated quinolones. It has been shown to inhibit the replication of herpes simplex virus type 1 and 2 in cell culture and has been proposed for use as a topical antiviral drug. Penigequinolone A also inhibits the growth of some bacteria, such as methicillin-resistant staphylococcus aureus (MRSA), by inhibiting protein synthesis.
Molecular Weight	467.55 g/mol
Molecular Formula	C27H33NO6
Canonical SMILES	CC1(CCC(OC1)(C)/C=C/C2=C(C3=C(C=C2)NC(=O)C(C3(C4=CC=C(C=C4)OC)O)OC)O)C

Custom Q&A

What is the chemical formula of penigequinolone A?

The chemical formula of penigequinolone A is C27H33NO6.

What is the molecular weight of penigequinolone A?

The molecular weight of penigequinolone A is 467.55.

What is the predicted boiling point of penigequinolone A?

The predicted boiling point of penigequinolone A is 652.8±55.0 °C.

In what form does penigequinolone A exist?

Penigequinolone A exists in solid form.

What is the storage temperature recommendation for penigequinolone A?

It is recommended to store penigequinolone A at -20°C.

What is the solubility of penigequinolone A?

Penigequinolone A is soluble in DMSO.

How is penigequinolone A used in the industry?

Penigequinolone A is a rare fungal metabolite produced by selected Penicillium species and is used as a pollen growth inhibitor.

What is the main chemical property of penigequinolone A?

The main chemical property mentioned is its pka value, which is 8.91±0.60.

What is penigequinolone A defined as in ChEBI?

Penigequinolone A is defined as a quinolone in ChEBI.

※ Please kindly note that our products are for research use only.