Peraksine

Peraksine

Inquiry
Catalog Number ACM15527807
CAS Number 15527-80-7
Synonyms (17R)-17,19-Epoxy-19,20β-dihydro-21α-methyl-18-norsarpagan-17-ol
Molecular Weight 310.4
InChI InChI=1S/C19H22N2O2/c1-9-13-8-23-19(22)17-11(13)6-16-18-12(7-15(17)21(9)16)10-4-2-3-5-14(10)20-18/h2-5,9,11,13,15-17,19-20,22H,6-8H2,1H3
InChI Key LVOPRJWLXUCHRL-UHFFFAOYSA-N
Purity 95%+
Complexity 514
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 310.168127949
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 2
Monoisotopic Mass 310.168127949
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 48.5 Ų
Custom Q&A

What is the chemical formula for PERAKSINE?

The chemical formula for PERAKSINE is C19H22N2O2.

What is the molecular weight of PERAKSINE?

The molecular weight of PERAKSINE is 310.4.

What is the melting point of PERAKSINE?

The melting point of PERAKSINE is 184 °C.

In what solvents is PERAKSINE soluble?

PERAKSINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of PERAKSINE?

The predicted boiling point of PERAKSINE is 536.4±50.0 °C.

What is the predicted density of PERAKSINE?

The predicted density of PERAKSINE is 1.39±0.1 g/cm3.

What is the predicted pka of PERAKSINE?

The predicted pka of PERAKSINE is 12.91±0.40.

What are some synonyms for PERAKSINE?

Some synonyms for PERAKSINE include Vomifoline and (17R)-17,19-Epoxy-19,20β-dihydro-21α-methyl-18-norsarpagan-17-ol.

What is the CAS number for PERAKSINE?

The CAS number for PERAKSINE is 15527-80-7.

※ Please kindly note that our products are for research use only.