Pericyclivine

Catalog Number	ACM975779
CAS Number	975-77-9
Structure
Synonyms	(16S)-Sarpagan-17-oic acid methyl ester
Molecular Weight	322.4
InChI	InChI=1S/C20H22N2O2/c1-3-11-10-22-16-9-14-12-6-4-5-7-15(12)21-19(14)17(22)8-13(11)18(16)20(23)24-2/h3-7,13,16-18,21H,8-10H2,1-2H3/b11-3+/t13-,16-,17,18/m1/s1
InChI Key	VXRAIAAMNNTQES-HMVDDCJGSA-N
Purity	95%+
Complexity	574
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	322.168127949
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\CN2[C@@H]3CC4=C(C2C[C@H]1C3C(=O)OC)NC5=CC=CC=C45
Monoisotopic Mass	322.168127949
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	45.3 Ų

Custom Q&A

What is the chemical name for pericyclivine?

The chemical name for pericyclivine is (16S)-Sarpagan-17-oic acid methyl ester.

What is the molecular formula of pericyclivine?

The molecular formula of pericyclivine is C20H22N2O2.

What is the molecular weight of pericyclivine?

The molecular weight of pericyclivine is 322.406 g/mol.

What is the CAS number for pericyclivine?

The CAS number for pericyclivine is 975-77-9.

What is the melting point of pericyclivine?

The melting point of pericyclivine is 232-233 °C.

What is the predicted boiling point of pericyclivine?

The predicted boiling point of pericyclivine is 489.2±45.0 °C.

What is the predicted density of pericyclivine?

The predicted density of pericyclivine is 1.29±0.1 g/cm3.

What is the predicted pKa value of pericyclivine?

The predicted pKa value of pericyclivine is 17.55±0.40.

What are some synonyms for pericyclivine?

Some synonyms for pericyclivine include Deformoakuammidine, NSC 91996, and sarpagan-17-oic acid methyl ester.

※ Please kindly note that our products are for research use only.