Periglaucine A

Catalog Number	ACM1025023044
CAS Number	1025023-04-4
Synonyms	(7alpha,8beta,10beta)-8,10-Epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]hasubanan-6-one
Molecular Weight	373.4
InChI	InChI=1S/C20H23NO6/c1-21-5-4-18-8-13(22)17(23-2)20(24-3)19(18,21)9-16(27-20)11-6-14-15(7-12(11)18)26-10-25-14/h6-7,16-17H,4-5,8-10H2,1-3H3/t16-,17+,18-,19-,20-/m0/s1
InChI Key	QJDYNQYLCIPODD-WPVAHCMFSA-N
Purity	95%+
Complexity	687
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	373.15253745
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CC[C@@]23[C@]14C[C@@H](C5=CC6=C(C=C52)OCO6)O[C@]4([C@@H](C(=O)C3)OC)OC
Monoisotopic Mass	373.15253745
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the molecular formula of Periglaucine A?

The molecular formula of Periglaucine A is C20H23NO6.

What is the molecular weight of Periglaucine A?

The molecular weight of Periglaucine A is 373.4.

What is the CAS number for Periglaucine A?

The CAS number for Periglaucine A is 1025023-04-4.

What are the synonyms for Periglaucine A?

The synonyms for Periglaucine A include (7alpha,8beta,10beta)-8,10-Epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]hasubanan-6-one and Hasubanan-6-one, 8,10-epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]-, (7α,8β,10β)-.

What is the predicted boiling point of Periglaucine A?

The predicted boiling point of Periglaucine A is 509.5±50.0 °C.

What is the predicted density of Periglaucine A?

The predicted density of Periglaucine A is 1.43±0.1 g/cm3.

What is the predicted pKa of Periglaucine A?

The predicted pKa of Periglaucine A is 6.65±0.60.

What is the role of Periglaucine A?

Periglaucine A is an isoquinoline alkaloid and it has a role as a metabolite.

What are some potential applications of Periglaucine A?

Potential applications of Periglaucine A can include pharmaceutical research, drug development, and biological studies due to its alkaloid nature.

How can Periglaucine A be synthesized?

Periglaucine A can be synthesized through chemical reactions involving the appropriate precursors and reagents to form the isoquinoline alkaloid structure.

※ Please kindly note that our products are for research use only.