Periglaucine B

Catalog Number	ACM1025023055
CAS Number	1025023-05-5
Synonyms	(7beta,8beta,10beta)-8,10-Epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]-hasubanan-6-one
Molecular Weight	373.4
InChI	InChI=1S/C20H23NO6/c1-21-5-4-18-8-13(22)17(23-2)20(24-3)19(18,21)9-16(27-20)11-6-14-15(7-12(11)18)26-10-25-14/h6-7,16-17H,4-5,8-10H2,1-3H3/t16-,17-,18-,19-,20-/m0/s1
InChI Key	QJDYNQYLCIPODD-HVTWWXFQSA-N
Purity	95%+
Complexity	687
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	373.15253745
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CC[C@@]23[C@]14C[C@@H](C5=CC6=C(C=C52)OCO6)O[C@]4([C@H](C(=O)C3)OC)OC
Monoisotopic Mass	373.15253745
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the chemical formula for Periglaucine B?

The chemical formula for Periglaucine B is C20H23NO6.

What is the molecular weight of Periglaucine B?

The molecular weight of Periglaucine B is 373.39972.

What is the boiling point of Periglaucine B?

The boiling point of Periglaucine B is predicted to be 509.5±50.0 °C.

What is the predicted density of Periglaucine B?

The predicted density of Periglaucine B is 1.43±0.1 g/cm3.

What is the pKa value of Periglaucine B?

The pKa value of Periglaucine B is predicted to be 6.65±0.60.

How is Periglaucine B classified in terms of its chemical structure?

Periglaucine B is classified as an isoquinoline alkaloid.

What role does Periglaucine B play in biological processes?

Periglaucine B has a role as a metabolite.

What are some synonyms for Periglaucine B?

Some synonyms for Periglaucine B include (7beta,8beta,10beta)-8,10-Epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]-hasubanan-6-one and Hasubanan-6-one, 8,10-epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]-, (7β,8β,10β)-.

What is Periglaucine B commonly used for?

Periglaucine B is commonly used in research as a chemical compound for various studies.

How is Periglaucine B predicted to behave in certain conditions?

Periglaucine B is predicted to have certain chemical properties such as boiling point, density, and pKa values under specific conditions.

※ Please kindly note that our products are for research use only.