Perlolyrine

Perlolyrine

Inquiry
Catalog Number ACM29700207
CAS Number 29700-20-7
Structure
Synonyms Substance YS
IUPAC Name [5-(9H-Pyrido[3,4-b]indol-1-yl)furan-2-yl]methanol
Molecular Weight 264.28
Molecular Formula C16H12N2O2
Canonical SMILES C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CC=C(O4)CO
InChI InChI=1S/C16H12N2O2/c19-9-10-5-6-14(20-10)16-15-12(7-8-17-16)11-3-1-2-4-13(11)18-15/h1-8,18-19H,9H2
InChI Key KFUCYPGCMLPUMT-UHFFFAOYSA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 351
Exact Mass 264.089877630
Heavy Atom Count 20
Monoisotopic Mass 264.089877630
Topological Polar Surface Area 62Ų
Custom Q&A

What is the chemical name of perlolyrine?

The chemical name of perlolyrine is 5-(9H-Pyrido[3,4-b]indol-1-yl)-2-furanmethanol.

What are some synonyms of perlolyrine?

Some synonyms of perlolyrine are perlolyrine, 2-Furanmethanol, 5-(9H-pyrido[3,4-b]indol-1-yl)-, and Perlolyrin.

What is the CAS number of perlolyrine?

The CAS number of perlolyrine is 29700-20-7.

What is the molecular formula of perlolyrine?

The molecular formula of perlolyrine is C16H12N2O2.

What is the molecular weight of perlolyrine?

The molecular weight of perlolyrine is 264.28.

What is the melting point of perlolyrine?

The melting point of perlolyrine is 179-181 °C (Solv: ethanol).

What is the boiling point of perlolyrine?

The boiling point of perlolyrine is 533.9±45.0 °C (Predicted).

What is the density of perlolyrine?

The density of perlolyrine is 1.382±0.06 g/cm3 (Predicted).

What is the pKa value of perlolyrine?

The pKa value of perlolyrine is 13.85±0.10 (Predicted).

What are some uses of perlolyrine?

Perlolyrine is a useful research chemical that exhibits hypoglycemic effects and inhibited activities of α-glucosidase and glycogen phosphorylase in rats with alloxan-induced diabetes. It is also a chemical constituent found in traditional Chinese medicine.

※ Please kindly note that our products are for research use only.