Phenylalanine betaine

Phenylalanine betaine

Inquiry
Catalog Number ACM56755227
CAS Number 56755-22-7
Synonyms (2S)-3-Phenyl-2-(trimethylammonio)propanoate
Molecular Weight 207.27
InChI InChI=1S/C12H17NO2/c1-13(2,3)11(12(14)15)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m0/s1
InChI Key XTFQIRIHLGODFV-NSHDSACASA-N
Purity 95%+
Complexity 209
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 1
Exact Mass 207.125928785
Heavy Atom Count 15
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Isomeric SMILES C[N+](C)(C)[C@@H](CC1=CC=CC=C1)C(=O)[O-]
Monoisotopic Mass 207.125928785
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 40.1 Ų
Custom Q&A

What is the chemical name of Phenylalanine betaine?

The chemical name of Phenylalanine betaine is (2S)-3-Phenyl-2-(trimethylammonio)propanoate.

What are some synonyms of Phenylalanine betaine?

Some synonyms of Phenylalanine betaine are L-Phenylalanine βine, (alphaS)-alpha-Carboxy-N,N,N-trimethylbenzeneethanaminium inner salt, and Phenylalanineβine.

What is the CAS number of Phenylalanine betaine?

The CAS number of Phenylalanine betaine is 56755-22-7.

What is the molecular formula of Phenylalanine betaine?

The molecular formula of Phenylalanine betaine is C12H17NO2.

What is the molecular weight of Phenylalanine betaine?

The molecular weight of Phenylalanine betaine is 207.26888.

How is Phenylalanine betaine defined by ChEBI?

Phenylalanine betaine is defined by ChEBI as an L-phenylalanine derivative obtained by trimethylation of the amino function of L-phenylalanine.

What is the enantiomer of Phenylalanine betaine?

The enantiomer of Phenylalanine betaine is D-phenylalanine betaine.

What can be said about the chemical structure of Phenylalanine betaine?

The chemical structure of Phenylalanine betaine includes a phenyl group, a carboxylic acid group, and a trimethylammonium group.

How is Phenylalanine betaine used in synthesis?

Phenylalanine betaine is used in synthesis as a derivative of L-phenylalanine obtained through trimethylation of the amino function.

What role does phenylalanine betaine play in chemical reactions or processes?

Phenylalanine betaine can serve as a chiral catalyst or modifier in certain chemical reactions, given its unique structure and properties as a betaine derivative of phenylalanine.

※ Please kindly note that our products are for research use only.