Picrasidine Q

Catalog Number	ACM101219618
CAS Number	101219-61-8
Structure
Synonyms	4-Hydroxycanthin-6-one
Molecular Weight	266.25
InChI	InChI=1S/C15H10N2O3/c1-20-14-13(18)11-12-9(6-7-16-11)8-4-2-3-5-10(8)17(12)15(14)19/h2-7,18H,1H3
InChI Key	HJFNTSGIQCFHGP-UHFFFAOYSA-N
Purity	90%+
Complexity	476
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	266.06914219
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	266.06914219
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	64.4 Ų

Custom Q&A

What is the chemical formula for Picrasidine Q?

The chemical formula for Picrasidine Q is C15H10N2O3.

What is the molecular weight of Picrasidine Q?

The molecular weight of Picrasidine Q is 266.25 g/mol.

What is another name for Picrasidine Q?

Another name for Picrasidine Q is 4-Hydroxycanthin-6-one.

What is the CAS number for Picrasidine Q?

The CAS number for Picrasidine Q is 101219-61-8.

What is the boiling point of Picrasidine Q?

The predicted boiling point of Picrasidine Q is 433.0±45.0 °C.

What is the predicted density of Picrasidine Q?

The predicted density of Picrasidine Q is 1.51±0.1 g/cm3.

What is the pka value of Picrasidine Q?

The predicted pka value of Picrasidine Q is 5.69±0.20.

How many oxygen atoms are in the molecular structure of Picrasidine Q?

There are three oxygen atoms in the molecular structure of Picrasidine Q.

What is the predicted boiling point range of Picrasidine Q?

The predicted boiling point range of Picrasidine Q is ±45.0 °C.

What is the predicted density range of Picrasidine Q?

The predicted density range of Picrasidine Q is ±0.1 g/cm3.

※ Please kindly note that our products are for research use only.