Pilosine

Pilosine

Inquiry
Catalog Number ACM13640283-1
CAS Number 13640-28-3
Structure
Description Pilosine is a fluorescent derivative of histidine that is found in the genus Pilosa. It has been shown to be a substrate for epiisopiloturine, an antibiotic that inhibits bacterial growth by binding to the 50S ribosomal subunit. Pilosine also has clinical relevance and can be used as an alternative to nonsteroidal anti-inflammatory drugs (NSAIDs) because it does not show any signs of cytotoxicity or genotoxicity. Studies have shown that pilosine can inhibit COX-2 enzyme activity and thus reduce inflammation. Pilosine has been synthesized and profiled using chromatographic methods with cell culture assays on the effects of this compound on cellular viability.
Synonyms Dihydro-3-[(R)-hydroxyphenylmethyl]-4-[(1-methyl-1H-imidazol-5-yl)methyl]-,(3R,4R)-2(3H)-furanone
Molecular Weight 286.33 g/mol
Molecular Formula C16H18N2O3
Canonical SMILES CN1C=NC=C1C[C@H]2COC(=O)[C@H]2[C@H](C3=CC=CC=C3)O
Custom Q&A

What is the chemical formula of Pilosine?

The chemical formula of Pilosine is C16H18N2O3.

What is the molecular weight of Pilosine?

The molecular weight of Pilosine is 286.33.

What is the CAS number for Pilosine?

The CAS number for Pilosine is 13640-28-3.

What are some synonyms for Pilosine?

Some synonyms for Pilosine include carpidine and [3R,(+)]-4,5-Dihydro-3β-[(R)-hydroxyphenylmethyl]-4β-[(1-methyl-1H-imidazole-5-yl)methyl]-2(3H)-furanone.

What are the chemical properties of Pilosine?

Pilosine has a melting point of 179°, a boiling point of 568.3±25.0 °C, and a density of 1.29±0.1 g/cm3.

What is the pka value of Pilosine?

The pka value of Pilosine is 13.59±0.20.

How is Pilosine defined in ChEBI?

In ChEBI, Pilosine is defined as a citraconoyl group.

What are some predicted properties of Pilosine?

Some predicted properties of Pilosine include a boiling point of 568.3±25.0 °C and a density of 1.29±0.1 g/cm3.

What is the specific rotation of Pilosine in alcohol?

The specific rotation of Pilosine in alcohol is +83.9°.

What category does Pilosine belong to in terms of product categories?

Pilosine belongs to the category of alkaloids in product categories.

※ Please kindly note that our products are for research use only.