Pingpeimine A

Pingpeimine A

Inquiry
Catalog Number ACM82841676-1
CAS Number 82841-67-6
Structure
Synonyms Cevane-3,6,14,16,20-pentol
IUPAC Name (1S,2S,6S,9S,10S,11R,12S,14R,15R,17S,18S,20S,23R,24S)-6,10,23-Trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol
Molecular Weight 463.6
Molecular Formula C27H45NO5
Canonical SMILES CC1CCC2C(C3C(CC4(C(C3CN2C1)CC5C4CC(C6C5(CCC(C6)O)C)O)O)O)(C)O
InChI InChI=1S/C27H45NO5/c1-14-4-5-23-26(3,32)24-16(13-28(23)12-14)17-9-18-19(27(17,33)11-22(24)31)10-21(30)20-8-15(29)6-7-25(18,20)2/h14-24,29-33H,4-13H2,1-3H3/t14-,15-,16-,17-,18-,19+,20+,21-,22-,23-,24+,25+,26+,27-/m0/s1
InChI Key IDFMBIWPULRZOJ-LPMWXLNZSA-N
Purity 98%+(HPLC)
Appearance Colorless needle-like crystals
Storage Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity 795
Exact Mass 463.32977354
Heavy Atom Count 33
Isomeric SMILES C[C@H]1CC[C@H]2[C@@]([C@H]3[C@H](C[C@@]4([C@H]([C@@H]3CN2C1)C[C@H]5[C@H]4C[C@@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O)O)O)(C)O
Monoisotopic Mass 463.32977354
Topological Polar Surface Area 104Ų
Custom Q&A

What is another name for Pingpeimine A?

Pingpeimine A is also known as Cevane-3,6,14,16,20-pentol, (3β,5α,6α,16β)-.

What is the molecular formula of Pingpeimine A?

The molecular formula of Pingpeimine A is C27H45NO5.

What is the molecular weight of Pingpeimine A?

The molecular weight of Pingpeimine A is 463.65.

What is the boiling point of Pingpeimine A?

The boiling point of Pingpeimine A is predicted to be 632.9±55.0 °C.

What is the density of Pingpeimine A?

The density of Pingpeimine A is 1.29.

What is the pKa value of Pingpeimine A?

The pKa value of Pingpeimine A is predicted to be 14.21±0.70.

What is Peimine and how is Pingpeimine A related to it?

Peimine is a steroidal alkaloid compound extracted from the Fritillaria species of medicinal plants, and Pingpeimine A is a derivative of Peimine.

What type of compound is Pingpeimine A?

Pingpeimine A is a steroidal alkaloid compound.

What is the role of Pingpeimine A in medicinal plants?

Pingpeimine A is extracted from medicinal plants and has various uses, potentially similar to Peimine.

What are some of the synonyms for Pingpeimine A?

Some synonyms for Pingpeimine A include Cevane-3,6,14,16,20-pentol, USP/EP/BP, and Benzo[7,8]fluoreno[2,1-b]quinolizine-3,5,6b,8,9(7H)-pentol.

※ Please kindly note that our products are for research use only.