Pingpeimine B

Catalog Number	ACM82851523
CAS Number	82851-52-3
Synonyms	5,17,22-Cevanine-3,6,12,14,16,20-hexol
IUPAC Name	(2S,6S,9S,10S,11S,12S,15R,17S,18S,20S,23R,24S)-6,10,23-Trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-1,10,12,14,17,20-hexol
Molecular Weight	479.6
Molecular Formula	C27H45NO6
Canonical SMILES	CC1CCC2C(C3C(CC4(C5CC(C6CC(CCC6(C5CC4(C3CN2C1)O)C)O)O)O)O)(C)O
InChI	InChI=1S/C27H45NO6/c1-14-4-5-22-25(3,32)23-19(13-28(22)12-14)26(33)10-18-16(27(26,34)11-21(23)31)9-20(30)17-8-15(29)6-7-24(17,18)2/h14-23,29-34H,4-13H2,1-3H3/t14-,15-,16+,17+,18-,19+,20-,21-,22-,23-,24-,25+,26?,27?/m0/s1
InChI Key	HMUQUHYFVPYNMA-PGVGQCOISA-N
Purity	98%+(HPLC)
Appearance	Colorless needle-like crystals
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	842
Exact Mass	479.32468816
Heavy Atom Count	34
Isomeric SMILES	C[C@H]1CC[C@H]2[C@@]([C@@H]3[C@H](CC4([C@@H]5C[C@@H]([C@H]6C[C@H](CC[C@@]6([C@H]5CC4([C@@H]3CN2C1)O)C)O)O)O)O)(C)O
Monoisotopic Mass	479.32468816
Topological Polar Surface Area	125Ų

Custom Q&A

What is the molecular formula of pingpeimine B?

The molecular formula of pingpeimine B is C27H45NO6.

What is the CAS number of pingpeimine B?

The CAS number of pingpeimine B is 82851-52-3.

What is the boiling point of pingpeimine B?

The boiling point of pingpeimine B is predicted to be 652.9±55.0 °C.

What is the density of pingpeimine B?

The density of pingpeimine B is predicted to be 1.34±0.1 g/cm3.

What is the pka value of pingpeimine B?

The pka value of pingpeimine B is predicted to be 13.56±0.70.

How is pingpeimine B classified chemically?

Pingpeimine B is classified as a steroidal alkaloid compound.

What is the source of pingpeimine B?

Pingpeimine B is extracted from the Fritillaria species of medicinal plants.

Can pingpeimine B be used in pharmaceuticals?

Yes, pingpeimine B is a compound used in pharmaceuticals.

What is the molecular weight of pingpeimine B?

The molecular weight of pingpeimine B is 479.66.

※ Please kindly note that our products are for research use only.