Pioglitazone hydrochloride

Catalog Number	ACM112529154-1
CAS Number	112529-15-4
Structure
Synonyms	Piomed
IUPAC Name	5-[[4-[2-(5-Ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride
Molecular Weight	392.9
Molecular Formula	C19H21ClN2O3S
Canonical SMILES	CCC1=CN=C(C=C1)CCOC2=CC=C(C=C2)CC3C(=O)NC(=O)S3.Cl
InChI	InChI=1S/C19H20N2O3S.ClH/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17;/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23);1H
InChI Key	GHUUBYQTCDQWRA-UHFFFAOYSA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	466
Exact Mass	392.0961414
Heavy Atom Count	26
Monoisotopic Mass	392.0961414
Topological Polar Surface Area	93.6Ų

Custom Q&A

What is the chemical formula of Pioglitazone hydrochloride?

The chemical formula of Pioglitazone hydrochloride is C19H21ClN2O3S.

What is the molecular weight of Pioglitazone hydrochloride?

The molecular weight of Pioglitazone hydrochloride is 392.9.

What is the melting point of Pioglitazone hydrochloride?

The melting point of Pioglitazone hydrochloride is 193-194°C.

What are the synonyms of Pioglitazone hydrochloride?

The synonyms of Pioglitazone hydrochloride include AD-4833, Pioditazone hydrochloride, and PIODLITAZONE HYDROCHLORIC.

How is Pioglitazone hydrochloride classified under BCS?

Pioglitazone hydrochloride is classified under BCS Class 2.

What is the color of Pioglitazone hydrochloride in its powder form?

Pioglitazone hydrochloride is white to off-white in color in its powder form.

How is Pioglitazone hydrochloride stored?

Pioglitazone hydrochloride should be stored at 2-8°C.

What is the therapeutic function of Pioglitazone hydrochloride?

Pioglitazone hydrochloride is used as an antidiabetic agent.

What is the brand name of Pioglitazone hydrochloride?

The brand name of Pioglitazone hydrochloride is Actos.

What is the main mechanism of action of Pioglitazone hydrochloride in treating diabetes?

Pioglitazone hydrochloride potently activates the nuclear receptor peroxisome proliferator-activated receptor gamma, which is believed to be involved in the regulation of insulin resistance and adipogenesis.

※ Please kindly note that our products are for research use only.