Pipecolinic acid

Catalog Number	ACM535751
CAS Number	535-75-1
Structure
Synonyms	DL-Pipecolinic acid
IUPAC Name	Piperidine-2-carboxylic acid
Molecular Weight	129.07
Molecular Formula	C6H11NO2
Canonical SMILES	C1CCNC(C1)C(=O)O
InChI	InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9)
InChI Key	HXEACLLIILLPRG-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	114
Exact Mass	129.078978594
Heavy Atom Count	9
Monoisotopic Mass	129.078978594
Topological Polar Surface Area	49.3Ų

Custom Q&A

What is the chemical formula of DL-Pipecolinic acid?

The chemical formula of DL-Pipecolinic acid is C6H11NO2.

What is the molecular weight of DL-Pipecolinic acid?

The molecular weight of DL-Pipecolinic acid is 129.16 g/mol.

What is the melting point of DL-Pipecolinic acid?

The melting point of DL-Pipecolinic acid is 282°C (dec.)(lit.).

What is the boiling point of DL-Pipecolinic acid?

The boiling point of DL-Pipecolinic acid is estimated to be 239.22°C.

What is the hazard code associated with DL-Pipecolinic acid?

The hazard code associated with DL-Pipecolinic acid is Xi.

What is the main usage of Pipecolic acid according to the reference?

Pipecolic acid is involved in synaptic transmission in the central nervous system.

What is the method recommended for purification of DL-Pipecolinic acid?

DL-Pipecolinic acid can be purified by crystallization from water.

What is the color of DL-Pipecolinic acid in its solid form?

DL-Pipecolinic acid appears as white to off-white in color in its solid form.

What safety precautions should be taken while handling DL-Pipecolinic acid?

Safety precautions include wearing protective clothing and avoiding contact with skin and eyes.

What is the NIST Chemistry Reference for DL-Pipecolinic acid?

The NIST Chemistry Reference for DL-Pipecolinic acid is Pipecolic acid(4043-87-2).

※ Please kindly note that our products are for research use only.