Pipercide

Catalog Number	ACM54794740
CAS Number	54794-74-0
Synonyms	(2E,4E,10E)-N-Isobutyl-11-(1,3-benzodioxole-5-yl)-2,4,10-undecatrienamide
Molecular Weight	355.5
InChI	InChI=1S/C22H29NO3/c1-18(2)16-23-22(24)12-10-8-6-4-3-5-7-9-11-19-13-14-20-21(15-19)26-17-25-20/h6,8-15,18H,3-5,7,16-17H2,1-2H3,(H,23,24)/b8-6+,11-9+,12-10+
InChI Key	RPOYGOULCHMVBB-ADDDGJNWSA-N
Purity	95%+
Complexity	496
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	355.21474379
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)CNC(=O)/C=C/C=C/CCCC/C=C/C1=CC2=C(C=C1)OCO2
Monoisotopic Mass	355.21474379
PhysicalState	Powder
Rotatable Bond Count	10
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical structure of Pipercide?

The chemical structure of Pipercide is (2E,4E,6E,10E)-11-benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)undeca-2,4,6,10-tetraenamide.

What are some synonyms for Pipercide?

Some synonyms for Pipercide include Retrofractamide B, Retrofractamide D, and Piperonal Impurity 8.

What is the CAS number for Pipercide?

The CAS number for Pipercide is 54794-74-0.

What is the molecular formula of Pipercide?

The molecular formula of Pipercide is C22H27NO3.

What is the usage of Pipercide?

Pipercide is a member of benzodioxoles.

What is the ChEBI definition of Pipercide?

The ChEBI definition of Pipercide is that it is a member of benzodioxoles.

What are the different names under which Pipercide is known?

Pipercide is also known as Retrofractamide B, Retrofractamide D, and Piperonal Impurity 8.

What is the molecular structure of Pipercide?

The molecular structure of Pipercide is a 2,4,6,10-tetraenamide with a benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)undeca moiety.

What is the significance of the benzodioxole group in Pipercide?

The benzodioxole group is a key structural feature in Pipercide, contributing to its chemical properties and potential biological activities.

※ Please kindly note that our products are for research use only.