Piperlonguminine

Catalog Number	ACM5950129
CAS Number	5950-12-9
Synonyms	5-Benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)penta-2,4-dienamide
Molecular Weight	273.33
Molecular Formula	C16H19NO3
InChI	InChI=1S/C16H19NO3/c1-12(2)10-17-16(18)6-4-3-5-13-7-8-14-15(9-13)20-11-19-14/h3-9,12H,10-11H2,1-2H3,(H,17,18)/b5-3+,6-4+
InChI Key	WHAAPCGHVWVUEX-GGWOSOGESA-N
Purity	95%+
Complexity	376
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	273.13649347
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)CNC(=O)/C=C/C=C/C1=CC2=C(C=C1)OCO2
Monoisotopic Mass	273.13649347
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical name of piperlonguminine?

The chemical name of piperlonguminine is (E,E)-Piperlonguminine.

What is the molecular formula of piperlonguminine?

The molecular formula of piperlonguminine is C16H19NO3.

In which plant is piperlonguminine found?

Piperlonguminine is found in the roots of Piper longum.

What properties does piperlonguminine exhibit in terms of antifungal, anticancer, antihyperlipidemic, and anti-inflammatory effects?

Piperlonguminine demonstrates antifungal, anticancer, antihyperlipidemic, and anti-inflammatory properties.

How does piperlonguminine potentially contribute to treating Alzheimer's disease?

Piperlonguminine has been shown to dose dependently decrease the expression of amyloid precursor protein and amyloid-β peptide in human neuroblastoma cells, suggesting it may have implications in treating Alzheimer's disease.

What is the melting point of piperlonguminine?

The melting point of piperlonguminine is 166-8°C.

What is the storage recommendation for piperlonguminine?

Piperlonguminine should be stored at -20°C.

What is the solubility of piperlonguminine in ethanol, DMSO, and dimethyl formamide?

The solubility of piperlonguminine is ≤3mg/ml in ethanol, 20mg/ml in DMSO, and 20mg/ml in dimethyl formamide.

What are the potential therapeutic effects of piperlonguminine in inhibiting melanin production in melanoma cells?

Piperlonguminine has been found to inhibit melanin production in melanoma B16 cells stimulated with α-MSH, 3-isobutyl-1-methylxanthine, or protoporphyrin IX, showing stronger depigmenting efficacy.

How does piperlonguminine demonstrate neuroprotective potential in rats with cerebral ischemia?

In vivo, intraperitoneal injection of piperlonguminine at 2.4 mg/kg was able to produce significant neuroprotective potential in rats with cerebral ischemia by attenuating neurological deficit scores, brain infarct volume, brain water content, and inhibiting the activation of NF-κB and MAPK.

※ Please kindly note that our products are for research use only.