Piperlotine D

Catalog Number	ACM958296134
CAS Number	958296-13-4
Synonyms	N-(3,4,5-Trimethoxy-Z-cinnamoyl)pyrrolidine
Molecular Weight	291.34
InChI	InChI=1S/C16H21NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/b7-6-
InChI Key	TYFKYDTUEMTUNY-SREVYHEPSA-N
Complexity	351
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	291.14705815
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC1=CC(=CC(=C1OC)OC)/C=C\C(=O)N2CCCC2
Monoisotopic Mass	291.14705815
PhysicalState	Oil
Rotatable Bond Count	5
Topological Polar Surface Area	48 Ų

Custom Q&A

What is the chemical formula of Piperlotine D?

The chemical formula of Piperlotine D is C16H21NO4.

What is the molecular weight of Piperlotine D?

The molecular weight of Piperlotine D is 291.34.

What are some synonyms for Piperlotine D?

Some synonyms for Piperlotine D are N-(3,4,5-trimethoxy-Z-cinnamoyl)pyrrolidine and (2Z)-1-(1-Pyrrolidinyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one.

What is the CAS number of Piperlotine D?

The CAS number of Piperlotine D is 958296-13-4.

What is the predicted boiling point of Piperlotine D?

The predicted boiling point of Piperlotine D is 482.8±45.0 °C.

What is the predicted density of Piperlotine D?

The predicted density of Piperlotine D is 1.156±0.06 g/cm3.

What is the predicted pKa value of Piperlotine D?

The predicted pKa value of Piperlotine D is -0.94±0.20.

How many oxygen atoms are present in the chemical formula of Piperlotine D?

There are four oxygen atoms present in the chemical formula of Piperlotine D.

What functional groups are present in the structure of Piperlotine D?

The structure of Piperlotine D contains a pyrrolidine ring, a propen-1-one group, and a trimethoxyphenyl group.

※ Please kindly note that our products are for research use only.