Porphyroxine

Catalog Number	ACM18104240
CAS Number	18104-24-0
Synonyms	(6α)-2,8β-Dimethoxy-10,11-[methylenebis(oxy)]rheadan-3-ol
Molecular Weight	371.4
InChI	InChI=1S/C20H21NO6/c1-23-15-7-10-5-6-21-17-11-3-4-14-19(26-9-25-14)16(11)20(24-2)27-18(17)12(10)8-13(15)22/h3-4,7-8,17-18,20-22H,5-6,9H2,1-2H3/t17-,18+,20+/m1/s1
InChI Key	YLUOVOKBMSLYGX-HBFSDRIKSA-N
Purity	95%+
Complexity	535
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	371.13688739
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	CO[C@@H]1C2=C(C=CC3=C2OCO3)[C@@H]4[C@@H](O1)C5=CC(=C(C=C5CCN4)OC)O
Monoisotopic Mass	371.13688739
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	78.4 Ų

Custom Q&A

What is the chemical name of Porphyroxine?

The chemical name of Porphyroxine is (6α)-2,8β-Dimethoxy-10,11-[methylenebis(oxy)]rheadan-3-ol.

What are some synonyms for Porphyroxine?

Some synonyms for Porphyroxine are Papaverrubine D, and 1,3-Dioxolo[7,8][2]benzopyrano[3,4-a][3]benzazepin-11-ol, 5b,6,7,8,12b,14-hexahydro-10,14-dimethoxy-, (5bR,12bS,14S)-.

What is the CAS number for Porphyroxine?

The CAS number for Porphyroxine is 18104-24-0.

What is the molecular formula of Porphyroxine?

The molecular formula of Porphyroxine is C20H21NO6.

What is the molecular weight of Porphyroxine?

The molecular weight of Porphyroxine is 371.38384.

What is the Melting point of Porphyroxine?

The melting point of Porphyroxine is 134-135 °C.

What is the Boiling point of Porphyroxine?

The boiling point of Porphyroxine is predicted to be 531.0±50.0 °C.

What is the density of Porphyroxine?

The density of Porphyroxine is predicted to be 1.43±0.1 g/cm3.

What is the pka of Porphyroxine?

The pka of Porphyroxine is predicted to be 9.98±0.40.

What is the history and confusion around the alkaloid Porphyroxine?

The history of Porphyroxine is somewhat confused as compounds with this name were shown to be mixtures of alkaloids. The alkaloid has been firmly identified and its structure determined, containing methoxyl groups, an imino group, and a phenolic hydroxyl group.

※ Please kindly note that our products are for research use only.