Preskimmianine

Catalog Number	ACM38695419
CAS Number	38695-41-9
Structure
Synonyms	4,7,8-Trimethoxy-3-(3-methyl-2-butenyl)quinolin-2(1H)-one
Molecular Weight	303.35
InChI	InChI=1S/C17H21NO4/c1-10(2)6-7-12-15(21-4)11-8-9-13(20-3)16(22-5)14(11)18-17(12)19/h6,8-9H,7H2,1-5H3,(H,18,19)
InChI Key	OAEZQCLAAGSHHA-UHFFFAOYSA-N
Purity	95%+
Complexity	479
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	303.14705815
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	303.14705815
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	56.8 Ų

Custom Q&A

What is the chemical name of the compound with the synonym Preskimmianine?

The chemical name is 4,7,8-Trimethoxy-3-(3-methyl-2-butenyl)quinolin-2(1H)-one.

What is the CAS number of Preskimmianine?

The CAS number is 38695-41-9.

What is the molecular formula of Preskimmianine?

The molecular formula is C17H21NO4.

What is the molecular weight of Preskimmianine?

The molecular weight is 303.35 g/mol.

What is the boiling point of 4,7,8-Trimethoxy-3-(3-methyl-2-butenyl)quinolin-2(1H)-one?

The boiling point is predicted to be 483.5±45.0 °C.

What is the density of 4,7,8-Trimethoxy-3-(3-methyl-2-butenyl)quinolin-2(1H)-one?

The density is predicted to be 1.16±0.1 g/cm3.

What is the pka value of 4,7,8-Trimethoxy-3-(3-methyl-2-butenyl)quinolin-2(1H)-one?

The pka value is predicted to be 9.52±0.70.

Where has Preskimmianine been isolated from?

It has recently been isolated from the roots of Dictamnus alb us.

※ Please kindly note that our products are for research use only.