Procerine

Catalog Number	ACM68622811
CAS Number	68622-81-1
Molecular Weight	271.31
InChI	InChI=1S/C13H21NO5/c1-7(8(2)16)13(18)19-11-3-4-14-5-10(17)9(6-15)12(11)14/h7,9-12,15,17H,3-6H2,1-2H3/t7,9-,10,11+,12+/m0/s1
InChI Key	UEASBNMLRVSIRE-FWQKEWFGSA-N
Purity	95%+
Complexity	372
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	271.14197277
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(C(=O)C)C(=O)O[C@@H]1CCN2[C@@H]1[C@H](C(C2)O)CO
Monoisotopic Mass	271.14197277
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	87.1 Ų

Custom Q&A

What is the chemical formula of Procerine?

The chemical formula of Procerine is C13H21NO5.

What is the CAS number of Procerine?

The CAS number of Procerine is 68622-81-1.

What are the synonyms for Procerine?

The synonyms for Procerine are Butanoic acid, 2-methyl-3-oxo-, hexahydro-6-hydroxy-7-(hydroxymethyl)-1H-pyrrolizin-1-yl ester.

What is the predicted boiling point of Procerine?

The predicted boiling point of Procerine is 399.0±42.0 °C.

What is the predicted density of Procerine?

The predicted density of Procerine is 1.28±0.1 g/cm3.

What is the predicted pKa value of Procerine?

The predicted pKa value of Procerine is 11.65±0.46.

From where has Procerine been isolated?

Procerine has been isolated from Senecio procerus var. procerus.

What is the molecular weight of Procerine?

The molecular weight of Procerine is 271.31.

What is the chemical structure of Procerine?

The chemical structure of Procerine is 2-methyl-3-oxo-, hexahydro-6-hydroxy-7-(hydroxymethyl)-1H-pyrrolizin-1-yl ester.

※ Please kindly note that our products are for research use only.