Prometaphanine

Catalog Number	ACM6858851
CAS Number	6858-85-1
Synonyms	6,7-Didehydro-8β,10β-epoxy-3,4,7-trimethoxy-17-methylhasubanan-8-ol
Molecular Weight	359.4
InChI	InChI=1S/C20H25NO5/c1-21-10-9-19-8-7-15(25-3)18(23)20(19,21)11-13(22)12-5-6-14(24-2)17(26-4)16(12)19/h5-7,13,22H,8-11H2,1-4H3/t13-,19+,20+/m0/s1
InChI Key	WOJRBUGBSKAUMI-CJMONDIMSA-N
Purity	95%+
Complexity	621
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	359.1732729
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CC[C@@]23[C@@]1(C[C@@H](C4=C2C(=C(C=C4)OC)OC)O)C(=O)C(=CC3)OC
Monoisotopic Mass	359.1732729
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	68.2 Ų

Custom Q&A

What is the chemical name of the compound with the synonym Prometaphanine?

The chemical name is 6,7-Didehydro-8β,10β-epoxy-3,4,7-trimethoxy-17-methylhasubanan-8-ol.

What is the CAS number for Prometaphanine?

The CAS number is 6858-85-1.

What is the molecular formula of Prometaphanine?

The molecular formula is C20H25NO5.

What is the molecular weight of Prometaphanine?

The molecular weight is 359.42 g/mol.

What is the predicted boiling point of Prometaphanine?

The predicted boiling point is 544.4±50.0 °C.

In which solvents is Prometaphanine soluble?

Prometaphanine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does Prometaphanine come in?

Prometaphanine comes in a powder form.

What is the predicted pka value of Prometaphanine?

The predicted pka value is 12.33±0.40.

What is the source of Prometaphanine?

Prometaphanine is an amorphous alkaloid from Stephania japonica Miers.

How is Prometaphanine characterized?

Prometaphanine can be characterized using a crystalline methiodide, with a melting point of 207°C and an optical rotation of -32° (in MeOH).

※ Please kindly note that our products are for research use only.