Protostemotinine

Catalog Number	ACM169534854
CAS Number	169534-85-4
Synonyms	(3S,11S,11aS)-3'-Methoxy-4',9-dimethyl-3-[(2S,4S)-4-methyl-5-oxot etrahydro-2-furanyl]-2,3,5,6,7,8-hexahydro-1H,5'H,10H-spiro[cyclo penta[b]pyrrolo[1,2-a]azepine-11,2'-furan]-5',10-dione
Molecular Weight	415.5
InChI	InChI=1S/C23H29NO6/c1-12-11-17(29-20(12)26)16-8-9-22-15(7-5-6-10-24(16)22)13(2)18(25)23(22)19(28-4)14(3)21(27)30-23/h12,16-17H,5-11H2,1-4H3/t12-,16-,17-,22-,23+/m0/s1
InChI Key	SKYPPFSYUDCEQR-NMXNWEJOSA-N
Purity	98%+
Complexity	919
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	415.19948764
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@H]1C[C@H](OC1=O)[C@@H]2CC[C@]34N2CCCCC3=C(C(=O)[C@@]45C(=C(C(=O)O5)C)OC)C
Monoisotopic Mass	415.19948764
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	82.1 Ų

Custom Q&A

What is the product name of this chemical compound?

The product name is ProtosteMotinine.

Can you provide some synonyms for ProtosteMotinine?

Some synonyms include spiro[cyclopenta[b]pyrrolo[1,2-a]azepine-11,2'-furan]-5',10-dione and Stemona,Inhibitor.

What is the chemical formula for ProtosteMotinine?

The chemical formula is C23H29NO6.

What is the molecular weight of ProtosteMotinine?

The molecular weight is 415.48 g/mol.

What is the predicted boiling point of ProtosteMotinine?

The predicted boiling point is 690.7±55.0 °C.

What is the predicted density of ProtosteMotinine at 20 ºC and 760 Torr?

The predicted density is 1.31±0.1 g/cm3.

What is the predicted pKa value of ProtosteMotinine?

The predicted pKa value is 6.00±0.70.

What is the CAS number for ProtosteMotinine?

The CAS number is 169534-85-4.

What functional groups are present in the chemical structure of ProtosteMotinine?

The chemical structure of ProtosteMotinine contains a furan ring, a cyclopentane ring, and a ketone group.

What is the role of ProtosteMotinine in Stemona plants?

ProtosteMotinine is an inhibitor that plays a role in Stemona plants.

※ Please kindly note that our products are for research use only.