Pseudoakuammigine

Pseudoakuammigine

Inquiry
Catalog Number ACM2447703
CAS Number 2447-70-3
Synonyms 1,2-Dihydro-1-methyl-2β,16-(epoxymethano)akuammilan-17-oic acid methyl ester
Molecular Weight 366.5
InChI InChI=1S/C22H26N2O3/c1-4-14-12-24-10-9-21-15-7-5-6-8-17(15)23(2)22(21)18(24)11-16(14)20(21,13-27-22)19(25)26-3/h4-8,16,18H,9-13H2,1-3H3/b14-4+
InChI Key HAGBWVNSVWLTKY-LNKIKWGQSA-N
Purity 95%+
Complexity 737
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 366.1943427
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Isomeric SMILES C/C=C/1\CN2CCC34C5=CC=CC=C5N(C36C2CC1C4(CO6)C(=O)OC)C
Monoisotopic Mass 366.1943427
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 42 Ų
Custom Q&A

What is the chemical name of the compound "Pseudoakuammigine"?

The chemical name of the compound "Pseudoakuammigine" is 1,2-Dihydro-1-methyl-2β,16-(epoxymethano)akuammilan-17-oic acid methyl ester.

What are some synonyms for Pseudoakuammigine?

Some synonyms for Pseudoakuammigine are 10-Deoxyakuammine, Deoxyakuammine, and (16R)-2β,17-epoxy-1-methyl-1,2-dihydro-akuammilane-16-carboxylic acid methyl ester.

What is the CAS number for Pseudoakuammigine?

The CAS number for Pseudoakuammigine is 2447-70-3.

What is the molecular formula of Pseudoakuammigine?

The molecular formula of Pseudoakuammigine is C22H26N2O3.

What is the molecular weight of Pseudoakuammigine?

The molecular weight of Pseudoakuammigine is 366.46.

What is the boiling point of Pseudoakuammigine?

The predicted boiling point of Pseudoakuammigine is 498.0±45.0 °C.

In what solvents is Pseudoakuammigine soluble?

Pseudoakuammigine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the form of Pseudoakuammigine?

Pseudoakuammigine is in the form of a powder.

What is the predicted pKa value of Pseudoakuammigine?

The predicted pKa value of Pseudoakuammigine is 6.66±0.40.

In what field is Pseudoakuammigine used as a target?

Pseudoakuammigine is used as a target in Immunology & Inflammation related research.

※ Please kindly note that our products are for research use only.