Quassidine B

Quassidine B

Inquiry
Catalog Number ACM1207862370
CAS Number 1207862-37-0
Synonyms 4,8-Dimethoxy-alpha-9H-pyrido[3,4-b]indol-1-yl-9H-pyrido[3,4-b]indole-1-propanol
Molecular Weight 452.5
InChI InChI=1S/C27H24N4O3/c1-33-21-9-5-7-17-23-22(34-2)14-29-19(26(23)31-24(17)21)10-11-20(32)27-25-16(12-13-28-27)15-6-3-4-8-18(15)30-25/h3-9,12-14,20,30-32H,10-11H2,1-2H3
InChI Key WVRVQNNTQSYWRT-UHFFFAOYSA-N
Purity 95%+
Complexity 697
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 452.18484064
Heavy Atom Count 34
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 3
Monoisotopic Mass 452.18484064
PhysicalState Powder
Rotatable Bond Count 6
Topological Polar Surface Area 96 Ų
Custom Q&A

What is the product name of Quassidine B?

The product name of Quassidine B is Quassidine B.

What are the synonyms for Quassidine B?

The synonyms for Quassidine B are 4,8-Dimethoxy-alpha-9H-pyrido[3,4-b]indol-1-yl-9H-pyrido[3,4-b]indole-1-propanol and 9H-Pyrido[3,4-b]indole-1-propanol, 4,8-dimethoxy-α-9H-pyrido[3,4-b]indol-1-yl-.

What is the CAS number for Quassidine B?

The CAS number for Quassidine B is 1207862-37-0.

What is the molecular formula of Quassidine B?

The molecular formula of Quassidine B is C27H24N4O3.

What is the molecular weight of Quassidine B?

The molecular weight of Quassidine B is 452.5.

What is the chemical structure of Quassidine B?

The chemical structure of Quassidine B is a 9H-pyrido[3,4-b]indole-1-propanol with methoxy substitutions at positions 4 and 8.

How many carbon atoms are present in the molecular formula of Quassidine B?

There are 27 carbon atoms present in the molecular formula of Quassidine B.

What are the functional groups present in Quassidine B?

The functional groups present in Quassidine B are indole, methoxy, and propanol.

Is Quassidine B a natural product or a synthetic compound?

Quassidine B is a natural product, as it is derived from natural sources such as plants.

※ Please kindly note that our products are for research use only.