Rankinidine

Catalog Number	ACM106466664
CAS Number	106466-66-4
Structure
Molecular Weight	340.4
InChI	InChI=1S/C20H24N2O3/c1-3-12-10-21-16-9-20(18-8-13(12)14(16)11-25-18)15-6-4-5-7-17(15)22(24-2)19(20)23/h3-7,13-14,16,18,21H,8-11H2,1-2H3/b12-3+
InChI Key	ZXRGGMATGWCUBP-KGVSQERTSA-N
Purity	95%+
Complexity	606
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	340.17869263
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\CNC2CC3(C4CC1C2CO4)C5=CC=CC=C5N(C3=O)OC
Monoisotopic Mass	340.17869263
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	50.8 Ų

Custom Q&A

What is the product name of rankinidine?

The product name of rankinidine is rankinidine.

What are some synonyms for rankinidine?

Some synonyms for rankinidine include Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-1-methoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the CAS number for rankinidine?

The CAS number for rankinidine is 106466-66-4.

What is the molecular formula of rankinidine?

The molecular formula of rankinidine is C20H24N2O3.

What is the molecular weight of rankinidine?

The molecular weight of rankinidine is 340.42.

What is the specific stereochemistry of rankinidine?

The specific stereochemistry of rankinidine is (3S,3'Z,4'R,4'aS,7'R,9'aS).

How many carbon atoms are in the chemical structure of rankinidine?

There are 20 carbon atoms in the chemical structure of rankinidine.

※ Please kindly note that our products are for research use only.