Raubasine

Catalog Number	ACM483045
CAS Number	483-04-5
Description	Raubasine is a natural product that inhibits the human pathogens and has been shown to inhibit protein synthesis in human cells. It also inhibits the energy metabolism of human pathogens, which leads to their death. Raubasine has been shown to have long-term efficacy in humans and is effective against axonal growth. Raubasine is an inhibitor of dinucleotide phosphate (NADPH) reductase, which is involved in the metabolic disorders of skin cancer and cardiac disease. It binds to the enzyme activities of NADPH reductase, thereby inhibiting its activity and reducing its levels.
Synonyms	Ajmalicine
Molecular Weight	352.43 g/mol
Molecular Formula	C21H24N2O3
Canonical SMILES	C[C@H]1[C@H]2CN3CCC4=C([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)NC5=CC=CC=C45
Storage	store at 2℃-8℃, close container well, keep under inert gas: Nitrogen
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2933998000 - China: 2939799099
MDL Number	MFCD00042748

Custom Q&A

What is the chemical formula of Raubasine?

The chemical formula of Raubasine is C21H24N2O3.

At what temperature does Raubasine have a melting point?

Raubasine has a melting point of 258°C.

What is the solubility of Raubasine in water?

Raubasine is insoluble in water.

What is the specific rotation of Raubasine in chloroform?

The specific rotation of Raubasine in chloroform is [α]/D -65±3°, c = 1.

What is the safety hazard code for Raubasine?

The safety hazard code for Raubasine is Xn.

What are the main uses of Raubasine?

Raubasine is used as an antihypertensive and anti-ischemic agent for cerebral and peripheral conditions.

From which plant is Raubasine derived?

Raubasine is isolated from Vinca rosea L.

What is the primary role of Raubasine in the body as per ChEBI?

Raubasine is a selective alpha1-adrenoceptor antagonist used for the treatment of high blood pressure.

How does Raubasine crystalize when extracted from MeOH?

Raubasine crystallizes as colorless needles.

What is the target of Raubasine in the body?

The target of Raubasine in the body is P450, for example, CYP17.

※ Please kindly note that our products are for research use only.