Raucaffricine

Catalog Number	ACM31282072
CAS Number	31282-07-2
Structure
Synonyms	Vomilenine β-D-glucopyranoside
Molecular Weight	512.6
InChI	InChI=1S/C27H32N2O8/c1-3-12-13-8-16-23-27(14-6-4-5-7-15(14)28-23)9-17(19(13)24(27)35-11(2)31)29(16)25(12)37-26-22(34)21(33)20(32)18(10-30)36-26/h3-7,13,16-22,24-26,30,32-34H,8-10H2,1-2H3/b12-3+/t13-,16-,17-,18+,19?,20+,21-,22+,24?,25+,26-,27+/m0/s1
InChI Key	OSJPGOJPRNTSHP-BGYCQZOHSA-N
Purity	95%+
Complexity	1030
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	10
Exact Mass	512.21586598
Heavy Atom Count	37
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	4
Isomeric SMILES	C/C=C/1\[C@@H]2C[C@H]3C4=NC5=CC=CC=C5[C@]46C[C@@H](C2C6OC(=O)C)N3[C@@H]1O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O
Monoisotopic Mass	512.21586598
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	141 Ų

Custom Q&A

What is the chemical formula of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The chemical formula is C27H32N2O8.

What is the molecular weight of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The molecular weight is 512.56 g/mol.

What is the density of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The density is predicted to be 1.75±0.1 g/cm3.

What is the pka value of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The pka value is predicted to be 12.84±0.70.

What are some synonyms for (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

Some synonyms include Raucaffiricine, Raucaffricin, Raucaffricine, and Vomilenine β-D-glucopyranoside.

What is the CAS number of this compound?

The CAS number is 31282-07-2.

What is the EINECS number of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The EINECS number is 250-546-0.

What is the molar mass of (17R,19E,21alpha)-17-acetoxy-1,2,19,20-tetradehydro-1-demethylajmalan-21-yl beta-D-glucopyranoside?

The molar mass is 512.56 g/mol.

How many carbon, hydrogen, nitrogen, and oxygen atoms are present in the chemical formula of this compound?

There are 27 carbon atoms, 32 hydrogen atoms, 2 nitrogen atoms, and 8 oxygen atoms.

※ Please kindly note that our products are for research use only.