Raupin

Catalog Number	ACM482688
CAS Number	482-68-8
Synonyms	Sarpagine
Molecular Weight	310.4
InChI	InChI=1S/C19H22N2O2/c1-2-10-8-21-17-7-14-13-5-11(23)3-4-16(13)20-19(14)18(21)6-12(10)15(17)9-22/h2-5,12,15,17-18,20,22-23H,6-9H2,1H3/b10-2-/t12-,15+,17-,18-/m0/s1
InChI Key	VTVQHYQGTTVKDE-CCUKBNNFSA-N
Melting Point	320 °C
Purity	95%+
Complexity	522
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	310.168127949
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@H]([C@@H]2CC4=C3NC5=C4C=C(C=C5)O)CO
Monoisotopic Mass	310.168127949
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	59.5 Ų

Custom Q&A

What is another name for SARPAGINE as listed in the reference?

Raupin

What is the CAS number for SARPAGINE?

482-68-8

What is the molecular formula of SARPAGINE?

C19H22N2O2

What is the melting point of SARPAGINE?

320°C

In what solvents is SARPAGINE soluble?

Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted pka value of SARPAGINE?

10.24±0.40

What is the HazardClass of SARPAGINE?

6.1(b)

Where has SARPAGINE been isolated from?

Rauwolfia serpentina

How does the pharmacological effect of SARPAGINE compare to total Rauwolfia alkaloids on isolated rabbit uterus?

It has between three and four times the effect.

What effect does SARPAGINE have on the blood pressure in cats?

It lowers the blood pressure by 0.5-2.0 mgm per kilo body weight.

※ Please kindly note that our products are for research use only.