Rauvotetraphylline A

Catalog Number	ACM1422506497
CAS Number	1422506-49-7
Synonyms	(betaE,6S,8R,9S,10S)-beta-Ethylidene-6,7,8,9,10,11-hexahydro-2-hydroxy-9-(hydroxymethyl)-12-methyl-6,10-imino-5H-cyclooct[b]indole-8-ethanol
Molecular Weight	342.4
InChI	InChI=1S/C20H26N2O3/c1-3-11(9-23)13-7-19-20-15(8-18(22(19)2)16(13)10-24)14-6-12(25)4-5-17(14)21-20/h3-6,13,16,18-19,21,23-25H,7-10H2,1-2H3/b11-3-/t13-,16-,18-,19-/m0/s1
InChI Key	MVGDPTFDPKCFEM-BKRWUIHZSA-N
Purity	95%+
Complexity	525
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	342.1943427
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	4
Isomeric SMILES	C/C=C(/CO)\[C@@H]1C[C@H]2C3=C(C[C@@H]([C@H]1CO)N2C)C4=C(N3)C=CC(=C4)O
Monoisotopic Mass	342.1943427
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	79.7 Ų

Custom Q&A

What is the chemical name of Rauvotetraphylline A?

The chemical name of Rauvotetraphylline A is (betaE,6S,8R,9S,10S)-beta-Ethylidene-6,7,8,9,10,11-hexahydro-2-hydroxy-9-(hydroxymethyl)-12-methyl-6,10-imino-5H-cyclooct[b]indole-8-ethanol.

What is the synonym of Rauvotetraphylline A?

The synonyms of Rauvotetraphylline A are Rauvotetraphylline A and 6,10-Imino-5H-cyclooct[b]indole-8-ethanol.

What is the CAS number of Rauvotetraphylline A?

The CAS number of Rauvotetraphylline A is 1422506-49-7.

What is the molecular formula of Rauvotetraphylline A?

The molecular formula of Rauvotetraphylline A is C20H26N2O3.

What is the molecular weight of Rauvotetraphylline A?

The molecular weight of Rauvotetraphylline A is 342.44.

What is the boiling point of Rauvotetraphylline A?

The boiling point of Rauvotetraphylline A is predicted to be 563.7±50.0 °C.

What is the density of Rauvotetraphylline A?

The density of Rauvotetraphylline A is predicted to be 1.272±0.06 g/cm3.

What is the predicted pKa of Rauvotetraphylline A?

The predicted pKa of Rauvotetraphylline A is 10.22±0.60.

What is the structure of Rauvotetraphylline A?

The structure of Rauvotetraphylline A contains a cyclooct[b]indole ring system with ethylidene and hydroxyl functional groups.

What are some chemical properties of Rauvotetraphylline A?

Some chemical properties of Rauvotetraphylline A include its boiling point, density, and predicted pKa value.

※ Please kindly note that our products are for research use only.