Rauvotetraphylline C

Catalog Number	ACM1422506511
CAS Number	1422506-51-1
Molecular Weight	510.6
InChI	InChI=1S/C28H34N2O7/c1-3-14-17-10-21-23-18(15-6-4-5-7-19(15)29-23)11-20(16(17)9-8-13(2)32)30(21)27(14)37-28-26(35)25(34)24(33)22(12-31)36-28/h3-9,16-17,20-22,24-29,31,33-35H,10-12H2,1-2H3/b9-8,14-3+/t16?,17-,20+,21+,22-,24-,25+,26-,27-,28+/m1/s1
InChI Key	WJIXKXVKQDQVFT-IIKJYRLQSA-N
Purity	95%+
Complexity	942
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	9
Exact Mass	510.23660143
Heavy Atom Count	37
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	5
Isomeric SMILES	C/C=C/1\[C@H]2C[C@H]3C4=C(C[C@@H](C2C=CC(=O)C)N3[C@@H]1O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC=CC=C6N4
Monoisotopic Mass	510.23660143
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	136 Ų

Custom Q&A

What is the product name of Rauvotetraphylline C?

The product name of Rauvotetraphylline C is Rauvotetraphylline C.

What are the synonyms for Rauvotetraphylline C?

There are no synonyms listed for Rauvotetraphylline C.

What is the CAS number of Rauvotetraphylline C?

The CAS number of Rauvotetraphylline C is 1422506-51-1.

What is the molecular formula of Rauvotetraphylline C?

The molecular formula of Rauvotetraphylline C is C28H34N2O7.

What is the molecular weight of Rauvotetraphylline C?

The molecular weight of Rauvotetraphylline C is 510.59.

What is the boiling point of Rauvotetraphylline C?

The boiling point of Rauvotetraphylline C is predicted to be 771.4±60.0 °C.

What is the density of Rauvotetraphylline C?

The density of Rauvotetraphylline C is predicted to be 1.45±0.1 g/cm3.

What is the pka value of Rauvotetraphylline C?

The pka value of Rauvotetraphylline C is predicted to be 12.85±0.70.

What are the chemical properties of Rauvotetraphylline C?

The chemical properties of Rauvotetraphylline C include boiling point, density, and pka value.

※ Please kindly note that our products are for research use only.