Rauvovertine A

Catalog Number	ACM2055073759
CAS Number	2055073-75-9
Molecular Weight	326.4
InChI	InChI=1S/C19H22N2O3/c1-8-15-11-7-14-17-10(9-4-2-3-5-12(9)20-17)6-13(21(14)18(15)22)16(11)19(23)24-8/h2-5,8,11,13-16,18-20,22-23H,6-7H2,1H3/t8-,11+,13+,14+,15+,16,18-,19/m1/s1
InChI Key	AWYNNQCKGSFTMD-UXCCTWNPSA-N
Purity	95%+
Complexity	545
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	326.16304257
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@@H]1[C@H]2[C@@H]3C[C@H]4C5=C(C[C@@H](C3C(O1)O)N4[C@@H]2O)C6=CC=CC=C6N5
Monoisotopic Mass	326.16304257
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	68.7 Ų

Custom Q&A

What is the predicted pka of Rauvovertine A?

The predicted pka of Rauvovertine A is 12.70±0.60.

What are some synonyms for Rauvovertine A?

Some synonyms for Rauvovertine A are 17-epi-Rauvovertine A and 2055073-71-5.

What is the CAS number of Rauvovertine A?

The CAS number of Rauvovertine A is 2055073-75-9.

What is the molecular formula of Rauvovertine A?

The molecular formula of Rauvovertine A is C19H22N2O3.

What is the molecular weight of Rauvovertine A?

The molecular weight of Rauvovertine A is 326.4.

What is the predicted boiling point of Rauvovertine A?

The predicted boiling point of Rauvovertine A is 593.9±50.0 °C.

What is the predicted density of Rauvovertine A?

The predicted density of Rauvovertine A is 1.48±0.1 g/cm3.

※ Please kindly note that our products are for research use only.