Rauvovertine B

Catalog Number	ACM2055073726
CAS Number	2055073-72-6
Molecular Weight	326.4
InChI	InChI=1S/C19H22N2O3/c1-8-13-7-24-19(23)17-11(13)5-16-18-12(6-15(17)21(8)16)10-4-9(22)2-3-14(10)20-18/h2-4,8,11,13,15-17,19-20,22-23H,5-7H2,1H3/t8-,11+,13+,15-,16-,17,19/m0/s1
InChI Key	YQFGLJJOGMUWSM-QNSANRQCSA-N
Purity	95%+
Complexity	545
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	326.16304257
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@H]1[C@H]2COC(C3[C@@H]2C[C@@H]4N1[C@H]3CC5=C4NC6=C5C=C(C=C6)O)O
Monoisotopic Mass	326.16304257
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	68.7 Ų

Custom Q&A

What is the molecular formula of Rauvovertine B?

The molecular formula of Rauvovertine B is C19H22N2O3.

What are the synonyms for Rauvovertine B?

The synonyms for Rauvovertine B are also Rauvovertine B.

What is the CAS number for Rauvovertine B?

The CAS number for Rauvovertine B is 2055073-72-6.

What is the molecular weight of Rauvovertine B?

The molecular weight of Rauvovertine B is 326.4.

What is the boiling point of Rauvovertine B?

The predicted boiling point of Rauvovertine B is 592.0±50.0 °C.

What is the predicted density of Rauvovertine B?

The predicted density of Rauvovertine B is 1.48±0.1 g/cm3.

What is the predicted pka of Rauvovertine B?

The predicted pka of Rauvovertine B is 10.25±0.60.

How many carbon atoms are present in the molecular formula of Rauvovertine B?

There are 19 carbon atoms present in the molecular formula of Rauvovertine B.

※ Please kindly note that our products are for research use only.