Rauvovertine C

Catalog Number	ACM2055073748
CAS Number	2055073-74-8
Molecular Weight	321.4
InChI	InChI=1S/C20H23N3O/c1-10-14-9-21-20(24-2)18-12(14)7-17-19-13(8-16(18)23(10)17)11-5-3-4-6-15(11)22-19/h3-6,9-10,12,14,16-18,20,22H,7-8H2,1-2H3/t10-,12+,14+,16-,17-,18,20-/m0/s1
InChI Key	ZZHBMDPVMXMCCC-YBOQEZAPSA-N
Purity	95%+
Complexity	565
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	321.184112366
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@H]2C=N[C@H](C3[C@@H]2C[C@@H]4N1[C@H]3CC5=C4NC6=CC=CC=C56)OC
Monoisotopic Mass	321.184112366
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	40.6 Ų

Custom Q&A

What is the product name of the chemical compound with the CAS number 2055073-74-8?

The product name is Rauvovertine C.

What are the synonyms for Rauvovertine C?

There are no additional synonyms for Rauvovertine C.

What is the molecular formula of Rauvovertine C?

The molecular formula is C20H23N3O.

What is the molecular weight of Rauvovertine C?

The molecular weight is 321.42.

What is the predicted boiling point of Rauvovertine C?

The predicted boiling point is 519.7±50.0 °C.

What is the predicted density of Rauvovertine C?

The predicted density is 1.54±0.1 g/cm3.

What is the predicted pka value of Rauvovertine C?

The predicted pka value is 18.21±0.60.

※ Please kindly note that our products are for research use only.