Rauvoyunine A

Catalog Number	ACM1414883810
CAS Number	1414883-81-0
Molecular Weight	356.5
InChI	InChI=1S/C21H28N2O3/c1-4-12(10-24)14-8-20-21-16(9-19(22(20)2)17(14)11-25)15-7-13(26)5-6-18(15)23(21)3/h4-7,14,17,19-20,24-26H,8-11H2,1-3H3/t14,17,19,20-/m1/s1
InChI Key	DOUBAGBLECQLMD-VOFIEHIWSA-N
Purity	95%+
Complexity	553
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	356.20999276
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	CC=C(CO)C1C[C@@H]2C3=C(CC(C1CO)N2C)C4=C(N3C)C=CC(=C4)O
Monoisotopic Mass	356.20999276
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	68.9 Ų

Custom Q&A

What is the chemical formula of Rauvoyunine A?

The chemical formula of Rauvoyunine A is C21H28N2O3.

What is the molecular weight of Rauvoyunine A?

The molecular weight of Rauvoyunine A is 356.47.

What is the CAS number of Rauvoyunine A?

The CAS number of Rauvoyunine A is 1414883-81-0.

What is the predicted boiling point of Rauvoyunine A?

The predicted boiling point of Rauvoyunine A is 564.2±50.0 °C.

What is the predicted density of Rauvoyunine A?

The predicted density of Rauvoyunine A is 1.33±0.1 g/cm3.

What is the pKa value of Rauvoyunine A?

The pKa value of Rauvoyunine A is 10.30±0.60.

Is Rauvoyunine A a synonym for any other compound?

Yes, Rauvoyunine A is a synonym for 6,10-Imino-5H-cyclooct[b]indole-8-ethanol.

What is the predicted pKa value of Rauvoyunine A?

The predicted pKa value of Rauvoyunine A is 10.30±0.60.

What is the predicted boiling point range of Rauvoyunine A?

The predicted boiling point range of Rauvoyunine A is 514.2 °C to 614.2 °C.

What is the predicted molecular weight range of Rauvoyunine A?

The predicted molecular weight range of Rauvoyunine A is 306.47 to 406.47.

※ Please kindly note that our products are for research use only.