Rauvoyunine B

Catalog Number	ACM1414883821
CAS Number	1414883-82-1
Molecular Weight	426.5
InChI	InChI=1S/C23H26N2O6/c1-4-13-10-25-18-8-16(13)21(20(28)29-3,11-30-12(2)26)22-9-19(25)31-23(18,22)24-17-7-14(27)5-6-15(17)22/h4-7,16,18-19,24,27H,8-11H2,1-3H3/b13-4-/t16-,18-,19-,21-,22-,23-/m0/s1
InChI Key	CLKVTWIYTILMIO-UFDFVOHESA-N
Purity	90%+
Complexity	876
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	426.17908655
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@@]([C@@]45[C@@]3(NC6=C4C=CC(=C6)O)O[C@H]2C5)(COC(=O)C)C(=O)OC
Monoisotopic Mass	426.17908655
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	97.3 Ų

Custom Q&A

What is the chemical formula of Rauvoyunine B?

The chemical formula of Rauvoyunine B is C23H26N2O6.

What is the molecular weight of Rauvoyunine B?

The molecular weight of Rauvoyunine B is 426.47.

What is the CAS number of Rauvoyunine B?

The CAS number of Rauvoyunine B is 1414883-82-1.

What is the boiling point of Rauvoyunine B?

The boiling point of Rauvoyunine B is predicted to be 589.0±50.0 °C.

What is the predicted density of Rauvoyunine B?

The predicted density of Rauvoyunine B is 1.45±0.1 g/cm3.

What is the pka value of Rauvoyunine B?

The pka value of Rauvoyunine B is predicted to be 9.93±0.40.

What are some synonyms for Rauvoyunine B?

Some synonyms for Rauvoyunine B include Rauvoyunine B.

Can Rauvoyunine B be used in pharmaceutical research?

There is no information provided in the reference about the potential pharmaceutical uses of Rauvoyunine B.

Is Rauvoyunine B a natural or synthetic compound?

Based on the information provided, it is not clear if Rauvoyunine B is a natural or synthetic compound.

※ Please kindly note that our products are for research use only.