Ravenine

Catalog Number	ACM20105220
CAS Number	20105-22-0
Synonyms	1-Methyl-4-[(3-methyl-2-buten-1-yl)oxy]-2(1H)-quinolinone
Molecular Weight	243.3
InChI	InChI=1S/C15H17NO2/c1-11(2)8-9-18-14-10-15(17)16(3)13-7-5-4-6-12(13)14/h4-8,10H,9H2,1-3H3
InChI Key	MADRTKVOWFLSFO-UHFFFAOYSA-N
Melting Point	120-121 °C
Purity	95%+
Complexity	380
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	243.125928785
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	243.125928785
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the product name of the compound with CAS number 20105-22-0?

The product name is Ravenine.

What are the synonyms for Ravenine?

The synonyms are 1-Methyl-4-[(3-methyl-2-buten-1-yl)oxy]-2(1H)-quinolinone and 2(1H)-Quinolinone, 1-methyl-4-[(3-methyl-2-buten-1-yl)oxy]-.

What is the molecular formula of Ravenine?

The molecular formula is C15H17NO2.

What is the molecular weight of Ravenine?

The molecular weight is 243.3 g/mol.

What is the melting point of Ravenine?

The melting point is 120-121℃.

What is the predicted boiling point of Ravenine?

The predicted boiling point is 367.9±42.0 °C.

What is the predicted density of Ravenine?

The predicted density is 1.13±0.1 g/cm3.

What is the predicted pKa value of Ravenine?

The predicted pKa value is -0.49±0.40.

What is the chemical structure of Ravenine?

The chemical structure is 1-methyl-4-[(3-methyl-2-buten-1-yl)oxy]-2(1H)-quinolinone.

※ Please kindly note that our products are for research use only.