Rescinnamine

Catalog Number	ACM24815245
CAS Number	24815-24-5
Structure
Synonyms	3,4,5-Trimethoxycinnamoyl methyl reserpate
Molecular Weight	634.7
InChI	InChI=1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1
InChI Key	SZLZWPPUNLXJEA-QEGASFHISA-N
Melting Point	238-239 °C
Purity	95%+
Complexity	1080
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	634.28903092
Heavy Atom Count	46
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	1
Isomeric SMILES	CO[C@H]1[C@@H](C[C@@H]2CN3CCC4=C([C@H]3C[C@@H]2[C@@H]1C(=O)OC)NC5=C4C=CC(=C5)OC)OC(=O)/C=C/C6=CC(=C(C(=C6)OC)OC)OC
Monoisotopic Mass	634.28903092
PhysicalState	Powder
Rotatable Bond Count	11
Topological Polar Surface Area	118 Ų

Custom Q&A

What is the chemical formula of Rescinnamine?

The chemical formula of Rescinnamine is C35H42N2O9.

What is the melting point of Rescinnamine?

The melting point of Rescinnamine is 238-239°C.

What is the boiling point of Rescinnamine?

The boiling point of Rescinnamine is approximately 669.26°C.

What are the hazard codes associated with Rescinnamine?

The hazard codes associated with Rescinnamine are Xn.

What is the main usage of Rescinnamine?

Rescinnamine is mainly used as an antihypertensive agent.

How does Rescinnamine react to light exposure?

Rescinnamine darkens slowly when exposed to light.

Is Rescinnamine soluble in water?

Rescinnamine is insoluble in water.

What are the safety statements associated with Rescinnamine?

The safety statements associated with Rescinnamine are 22-45-36.

What is the general description of Rescinnamine?

Rescinnamine is described as an odorless white to cream-colored crystalline powder.

What is the Brand name of Rescinnamine?

The Brand name of Rescinnamine is Moderil (Pfizer).

※ Please kindly note that our products are for research use only.