Reserpine N-oxide

Catalog Number	ACM474486
CAS Number	474-48-6
Synonyms	(3β,20α)-11,17α-Dimethoxy-18β-[(3,4,5-trimethoxybenzoyl)oxy]-16β-(methoxycarbonyl)yohimban 4-oxide
Molecular Weight	624.7
InChI	InChI=1S/C33H40N2O10/c1-39-19-7-8-20-21-9-10-35(38)16-18-13-27(45-32(36)17-11-25(40-2)30(42-4)26(12-17)41-3)31(43-5)28(33(37)44-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,22+,24-,27-,28+,31+,35/m1/s1
InChI Key	VRKGMHQUKPFVFT-DMUFBCNISA-N
Purity	95%+
Complexity	1050
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	624.26829548
Heavy Atom Count	45
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	1
Isomeric SMILES	CO[C@H]1[C@@H](C[C@@H]2C[N+]3(CCC4=C([C@H]3C[C@@H]2[C@@H]1C(=O)OC)NC5=C4C=CC(=C5)OC)[O-])OC(=O)C6=CC(=C(C(=C6)OC)OC)OC
Monoisotopic Mass	624.26829548
PhysicalState	Powder
Rotatable Bond Count	10
Topological Polar Surface Area	133 Ų

Custom Q&A

What is the product name of Reserpine N-oxide?

The product name is Reserpin N-oxide.

What are some synonyms of Reserpine N-oxide?

Some synonyms include Renoxidine, Renoxydine, Reserpoxidine, and Reserpine N-oxide.

What is the CAS number of Reserpine N-oxide?

The CAS number is 474-48-6.

What is the chemical formula of Reserpine N-oxide?

The chemical formula is C33H40N2O10.

What is the melting point of Reserpine N-oxide?

The melting point is 218-220 °C (decomp).

In what solvents is Reserpine N-oxide soluble?

Reserpine N-oxide is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

In what form does Reserpine N-oxide exist?

It exists in the form of a powder.

What is the predicted pKa value of Reserpine N-oxide?

The predicted pKa value is 15.47±0.70.

How does the activity of Reserpin N-oxide compare to Reserpine?

Reserpin N-oxide shows half the activity of Reserpine.

What is the molecular weight of Reserpine N-oxide?

The molecular weight is 624.6781.

※ Please kindly note that our products are for research use only.