Retrorsine

Retrorsine

Inquiry
Catalog Number ACM480546-1
CAS Number 480-54-6
Structure
Description Pyrrolizidine alkaloid
Molecular Weight 351.39 g/mol
Molecular Formula C18H25NO6
Canonical SMILES C/C=C\1/C[C@H]([C@@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(CO)O)C
Storage store at 10℃-25℃, keep dry
Harmonized Tariff Code Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099
MDL Number MFCD00870195
Custom Q&A

What is the chemical formula of Retrorsine?

The chemical formula of Retrorsine is C18H25NO6.

What is the melting point of Retrorsine?

The melting point of Retrorsine is 208-211°C.

What is the hazard code for Retrorsine?

The hazard code for Retrorsine is T.

What are the safety risks associated with Retrorsine?

The safety risks associated with Retrorsine include risk statements 25 and safety statements 22-36/37/39-45.

What is the primary use of Retrorsine?

Retrorsine is a pyrrolizidine alkaloid that blocks the hepatocyte cell cycle, ultimately affecting hepatocyte proliferative capacity.

What is the safety profile of Retrorsine?

Retrorsine is considered a poison by ingestion, intraperitoneal, and intravenous routes, and it is a questionable carcinogen with experimental neoplastigenic and tumorigenic data.

What is the molecular weight of Retrorsine?

The molecular weight of Retrorsine is 351.39 g/mol.

What is the boiling point estimate for Retrorsine?

The boiling point estimate for Retrorsine is 485.2°C.

What is the refractive index of Retrorsine?

The refractive index of Retrorsine is estimated to be 1.5100.

※ Please kindly note that our products are for research use only.