Rivularine

Catalog Number	ACM723784
CAS Number	723-78-4
Synonyms	7-O-Angelylheliotridine
Molecular Weight	237.29
InChI	InChI=1S/C13H19NO3/c1-3-9(2)13(16)17-11-5-7-14-6-4-10(8-15)12(11)14/h3-4,11-12,15H,5-8H2,1-2H3/b9-3-/t11-,12+/m0/s1
InChI Key	TYGYPIIOOQNWBU-ZVRIXJHSSA-N
Purity	95%+
Complexity	373
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	237.13649347
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(/C)\C(=O)O[C@H]1CCN2[C@@H]1C(=CC2)CO
Monoisotopic Mass	237.13649347
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	49.8 Ų

Custom Q&A

What is the chemical formula for 7-O-Angelylheliotridine?

The chemical formula for 7-O-Angelylheliotridine is C13H19NO3.

What is the molecular weight of 7-O-Angelylheliotridine?

The molecular weight of 7-O-Angelylheliotridine is 237.29.

What is the melting point of 7-O-Angelylheliotridine?

The melting point of 7-O-Angelylheliotridine is 116-117 °C.

What is the boiling point of 7-O-Angelylheliotridine?

The boiling point of 7-O-Angelylheliotridine is 343.0±42.0 °C.

What is the density of 7-O-Angelylheliotridine?

The density of 7-O-Angelylheliotridine is 1.18±0.1 g/cm3.

What is the pka value of 7-O-Angelylheliotridine?

The pka value of 7-O-Angelylheliotridine is 14.63±0.10.

What is the synonym of O-7-Angelylheliotridine?

One synonym of O-7-Angelylheliotridine is Rivularine.

What is the usage of O-7-Angelylheliotridine?

O-7-Angelylheliotridine is a member of pyrrolizines.

What is the CAS number for O-7-Angelylheliotridine?

The CAS number for O-7-Angelylheliotridine is 723-78-4.

What is another name for 7-O-Angelylheliotridine?

Another name for 7-O-Angelylheliotridine is Angelic acid 7-ester with heliotridine.

※ Please kindly note that our products are for research use only.