Rosiglitazone

Catalog Number	ACM122320734-1
CAS Number	122320-73-4
Structure
Synonyms	Avandia
IUPAC Name	5-[[4-[2-[Methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione
Molecular Weight	357.43
Molecular Formula	C18H19N3O3S
Canonical SMILES	CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3
InChI	InChI=1S/C18H19N3O3S/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15/h2-9,15H,10-12H2,1H3,(H,20,22,23)
InChI Key	YASAKCUCGLMORW-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	469
Exact Mass	357.11471265
Heavy Atom Count	25
Monoisotopic Mass	357.11471265
Topological Polar Surface Area	96.8Ų

Custom Q&A

What is the molecular formula of Rosiglitazone?

The molecular formula of Rosiglitazone is C18H19N3O3S.

What is the CAS number of Rosiglitazone?

The CAS number of Rosiglitazone is 122320-73-4.

What is the safety information associated with Rosiglitazone?

The hazard code for Rosiglitazone is Xi, and the risk statements include 36/38.

How does Rosiglitazone function in the body?

Rosiglitazone works by making the cells in the body more sensitive to naturally produced insulin.

What is the main indication for using Rosiglitazone?

Rosiglitazone is primarily used to lower blood glucose levels in patients with type 2 diabetes mellitus.

What is the storage temperature recommended for Rosiglitazone?

Rosiglitazone should be stored at 2-8°C.

What is the color of Rosiglitazone?

Rosiglitazone is described as white to off-white in color.

How does Rosiglitazone work on a molecular level?

Rosiglitazone is a potent agonist for PPARγ, which regulates gene expression and increases insulin sensitivity in peripheral tissues.

What is the brand name under which Rosiglitazone is marketed?

Rosiglitazone is marketed under the brand name Avandia by GlaxoSmithKline.

What are some potential side effects associated with Rosiglitazone?

Rosiglitazone may cause a modest increase in low-density lipoprotein and triglyceride concentrations, but it is unclear if it has any long-term clinical significance.

※ Please kindly note that our products are for research use only.