Rubiyunnanin C

Catalog Number	ACM1261030049
CAS Number	1261030-04-9
Molecular Weight	828.9
InChI	InChI=1S/C43H52N6O11/c1-24-38(52)46-31(17-19-37(51)59-7)42(56)47(3)32(20-26-8-13-29(58-6)14-9-26)40(54)45-25(2)41(55)49(5)34-21-27-10-15-30(16-11-27)60-36-23-28(12-18-35(36)50)22-33(39(53)44-24)48(4)43(34)57/h8-16,18,23-25,31-34,50H,17,19-22H2,1-7H3,(H,44,53)(H,45,54)(H,46,52)/t24-,25+,31+,32+,33+,34+/m1/s1
InChI Key	LGZQUONMJBBEDW-DETZFJOKSA-N
Purity	95%+
Complexity	1550
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	828.3694065
Heavy Atom Count	60
Hydrogen Bond Acceptor Count	11
Hydrogen Bond Donor Count	4
Isomeric SMILES	C[C@@H]1C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H]2CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H](C(=O)N1)N(C2=O)C)O)C)C)CC5=CC=C(C=C5)OC)C)CCC(=O)OC
Monoisotopic Mass	828.3694065
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	213 Ų

Custom Q&A

What is the chemical formula for Rubiyunnanin C?

The chemical formula for Rubiyunnanin C is C43H52N6O11.

What is the molecular weight of Rubiyunnanin C?

The molecular weight of Rubiyunnanin C is 828.90658.

What is the CAS number for Rubiyunnanin C?

The CAS number for Rubiyunnanin C is 1261030-04-9.

What is the melting point of Rubiyunnanin C?

The melting point of Rubiyunnanin C is 253-254 °C.

What is the predicted boiling point of Rubiyunnanin C?

The predicted boiling point of Rubiyunnanin C is 1109.7±65.0 °C.

What is the density of Rubiyunnanin C?

The density of Rubiyunnanin C is 1.200±0.06 g/cm3.

What is the predicted pka of Rubiyunnanin C?

The predicted pka of Rubiyunnanin C is 9.11±0.70.

What are some synonyms for Rubiyunnanin C?

Some synonyms for Rubiyunnanin C are Cyclo(D-alanyl-L-α-glutamyl-N,O-dimethyl-L-tyrosyl-L-alanyl-N-methyl-L-tyrosyl-3-hydroxy-N-methyl-L-tyrosyl), methyl ester, cyclic (5→63)-ether.

What kind of chemical compound is Rubiyunnanin C?

Rubiyunnanin C is a cyclic ether compound.

※ Please kindly note that our products are for research use only.