Rutacridone

Rutacridone

Inquiry
Catalog Number ACM17948333
CAS Number 17948-33-3
Structure
Synonyms (-)-1,11-Dihydro-5-hydroxy-11-methyl-2-(1-methylethenyl)furo[2,3-c]acridin-6(2H)-one
Molecular Weight 307.3
InChI InChI=1S/C19H17NO3/c1-10(2)15-8-12-16(23-15)9-14(21)17-18(12)20(3)13-7-5-4-6-11(13)19(17)22/h4-7,9,15,21H,1,8H2,2-3H3
InChI Key FHAGACMCMQYSNX-UHFFFAOYSA-N
Purity 95%+
Complexity 519
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 307.1208434
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 307.1208434
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 49.8 Ų
Custom Q&A

What is the chemical formula for rutacridone?

The chemical formula for rutacridone is C19H17NO3.

What is the molecular weight of rutacridone?

The molecular weight of rutacridone is 307.34.

What is the melting point of rutacridone?

The melting point of rutacridone is 161-162 °C.

What is the predicted boiling point of rutacridone?

The predicted boiling point of rutacridone is 535.0±50.0 °C.

What is the density of rutacridone?

The density of rutacridone is 1.292±0.06 g/cm3.

Where can rutacridone be found naturally?

Rutacridone is a minor alkaloid isolated from Ruta graveolens.

What is the pka value of rutacridone?

The pka value of rutacridone is 7.56±0.40.

What is rutacridone related to functionally?

Rutacridone is functionally related to an acridone.

What are some synonyms for rutacridone?

Some synonyms for rutacridone are (-)-1,11-Dihydro-5-hydroxy-11-methyl-2-(1-methylethenyl)furo[2,3-c]acridin-6(2H)-one and Rutacridon.

What is the CAS number for rutacridone?

The CAS number for rutacridone is 17948-33-3.

※ Please kindly note that our products are for research use only.