Rutaecarpine

Catalog Number	ACM84264
CAS Number	84-26-4
Structure
Synonyms	Rhetine
IUPAC Name	3,13,21-Triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15,17,19-octaen-14-one
Molecular Weight	287.32
Molecular Formula	C18H13N3O
Canonical SMILES	C1CN2C(=NC3=CC=CC=C3C2=O)C4=C1C5=CC=CC=C5N4
InChI	InChI=1S/C18H13N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(9-10-21(17)18)11-5-1-3-7-14(11)19-16/h1-8,19H,9-10H2
InChI Key	ACVGWSKVRYFWRP-UHFFFAOYSA-N
Boiling Point	429.62 °C
Melting Point	259.5-260 °C
Purity	98%
Density	1.2030 g/cm³
Appearance	White solid
Storage	Sealed in dry, 2-8 °C
Complexity	517
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	287.105862047
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	287.105862047
PhysicalState	Solid
Rotatable Bond Count	0
Topological Polar Surface Area	48.5 Ų

Custom Q&A

What is the chemical formula of Rutaecarpine?

The chemical formula of Rutaecarpine is C12H26N4O2.

What is the molecular weight of Rutaecarpine?

The molecular weight of Rutaecarpine is 258.36.

What are some synonyms for Rutaecarpine?

Some synonyms for Rutaecarpine are 3-[6-(dimethylcarbamoylamino)hexyl]-1,1-dimethyl-urea, 1,1'-Hexamethylenebis[3,3-dimethylurea], and N,N''-1,6-Hexanediylbis[N',N'-dimethylurea].

What is the boiling point of Rutaecarpine?

The boiling point of Rutaecarpine is predicted to be 512.3±33.0 °C.

What is the density of Rutaecarpine?

The density of Rutaecarpine is predicted to be 1.021±0.06 g/cm3.

What biological functions does Rutaecarpine have?

Rutaecarpine inhibits accumulation of macrophages and cholesterol in atherosclerotic lesions, increases cholesterol excretion, inhibits hypoxia-induced production of ROS and lactate dehydrogenase, suppresses apoptosis in myocardiocytes, and decreases corticosterone production.

What biological activity does Rutaecarpine exhibit?

Rutaecarpine exhibits anti-inflammatory, anti-atherosclerotic, cardioprotective, anorexigenic, and anti-obesity activities. It inhibits COX-2, decreases food intake, weight gain, and serum glucose, leptin, and insulin levels, and inhibits expression of neuropeptide Y and AgRP.

What is the mechanism of action of Rutaecarpine?

Rutaecarpine inhibits production of ROS, NO, and iNOS, potentially through inhibition of NADPH oxidase. It also inhibits arachidonic acid release, decreases production of prostaglandin E2, inhibits collagen-stimulated formation of thromboxane B2, and inosine monophosphate in various in vitro models.

What are the potential biological benefits of Rutaecarpine?

Potential biological benefits of Rutaecarpine include anti-inflammatory, anti-atherosclerotic, cardioprotective, anorexigenic, and anti-obesity effects.

How does Rutaecarpine impact cholesterol levels and cholesterol excretion?

Rutaecarpine inhibits accumulation of macrophages and cholesterol in atherosclerotic lesions and increases cholesterol excretion in animal models.

※ Please kindly note that our products are for research use only.