(S)-Goitrin

Catalog Number	ACM500129
CAS Number	500-12-9
Structure
Synonyms	(S)-5-Vinyloxazolidine-2-thione
IUPAC Name	(5S)-5-Ethenyl-1,3-oxazolidine-2-thione
Molecular Weight	129.18
Molecular Formula	C5H7NOS
Canonical SMILES	C=CC1CNC(=S)O1
InChI	InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m0/s1
InChI Key	UZQVYLOFLQICCT-BYPYZUCNSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	124
Exact Mass	129.02483502
Heavy Atom Count	8
Isomeric SMILES	C=C[C@H]1CNC(=S)O1
Monoisotopic Mass	129.02483502
Topological Polar Surface Area	53.4Ų

Custom Q&A

What is the chemical formula of DL-GOITRIN?

The chemical formula of DL-GOITRIN is C5H7NOS.

What is the molecular weight of DL-GOITRIN?

The molecular weight of DL-GOITRIN is 129.18 g/mol.

What is the melting point of DL-GOITRIN?

The melting point of DL-GOITRIN is 50°C.

What is the alpha value of DL-GOITRIN?

The alpha value of DL-GOITRIN is -70.5° (c = 2 in methanol).

What is the pka value of DL-GOITRIN at 25℃?

The pka value of DL-GOITRIN at 25℃ is 10.5.

What is the role of (S)-goitrin in traditional Chinese herbal medicine?

(S)-goitrin is a constituent of a traditional Chinese herbal medicine, Radix isatidis.

What is the function of DL-Goitrin in the body?

DL-Goitrin reduces the production of thyroid hormones such as thyroxine.

What is the Hazardous Substances Data for DL-GOITRIN?

The Hazardous Substances Data for DL-GOITRIN is 500-12-9.

What is the chemical name for DL-GOITRIN?

The chemical name for DL-GOITRIN is (S)-5-Ethenyl-2-oxazolidinethione.

What is another synonym for DL-GOITRIN?

Another synonym for DL-GOITRIN is (+/-)-GOITRIN.

※ Please kindly note that our products are for research use only.