(S)-Tetrahydrocolumbamine

(S)-Tetrahydrocolumbamine

Inquiry
Catalog Number ACM483341-1
CAS Number 483-34-1
Structure
Synonyms (S)-Isocorypalmine
Molecular Weight 341.4
InChI InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1
InChI Key KDFKJOFJHSVROC-INIZCTEOSA-N
Melting Point 240-241 °C
Purity 95%+
Complexity 461
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 1
Exact Mass 341.16270821
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 1
Isomeric SMILES COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC
Monoisotopic Mass 341.16270821
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 51.2 Ų
Custom Q&A

What is the chemical name for (S)-Isocorypalmine?

The chemical name for (S)-Isocorypalmine is (S)-Tetrahydrocolumbamine.

What are some synonyms for (S)-Isocorypalmine?

Some synonyms for (S)-Isocorypalmine include (-)-Isocorypalmine, l-Tetrahydrocolumbamine, and (13aS)-3,9,10-Trimethoxy-5,6,13,13a-tetrahydro-8H-dibenzo[a,g]quinolizine-2-ol.

What is the molecular formula of (S)-Isocorypalmine?

The molecular formula of (S)-Isocorypalmine is C20H23NO4.

What is the melting point of (S)-Isocorypalmine?

The melting point of (S)-Isocorypalmine is 240-241℃.

In what solvents is (S)-Isocorypalmine slightly soluble when heated?

(S)-Isocorypalmine is slightly soluble in chloroform and ethyl acetate when heated.

What is the boiling point of (S)-Isocorypalmine?

The predicted boiling point of (S)-Isocorypalmine is 501.2±50.0 °C.

How should (S)-Isocorypalmine be stored?

(S)-Isocorypalmine should be stored in a refrigerator.

What is the LD50 intravenous toxicity in mice for (S)-Isocorypalmine?

The LD50 intravenous toxicity in mice for (S)-Isocorypalmine is 133mg/kg.

What is the main source of (S)-Isocorypalmine?

(S)-Isocorypalmine is found in the EtOH extract of Bornean Tinosmiscium petiolare.

What is the target of (S)-Isocorypalmine in terms of biological activity?

(S)-Isocorypalmine targets cAMP, antifection, and dopamine receptors.

※ Please kindly note that our products are for research use only.