Sambutoxin

Catalog Number	ACM160047563
CAS Number	160047-56-3
Molecular Weight	453.6
InChI	InChI=1S/C28H39NO4/c1-7-17(2)14-18(3)15-20(5)27-19(4)8-13-24(33-27)25-26(31)23(16-29(6)28(25)32)21-9-11-22(30)12-10-21/h9-12,15-19,24,27,30-31H,7-8,13-14H2,1-6H3/b20-15+/t17-,18+,19+,24-,27+/m0/s1
InChI Key	FVYDVAOTXPELMH-SPRAOHHPSA-N
Purity	95%+
Complexity	790
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	453.28790873
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@H](C)C[C@@H](C)/C=C(\C)/[C@H]1[C@@H](CC[C@H](O1)C2=C(C(=CN(C2=O)C)C3=CC=C(C=C3)O)O)C
Monoisotopic Mass	453.28790873
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	70 Ų

Custom Q&A

What is the chemical formula for sambutoxin?

The chemical formula for sambutoxin is C28H39NO4.

What is the molecular weight of sambutoxin?

The molecular weight of sambutoxin is 453.61 g/mol.

What is the boiling point of sambutoxin?

The boiling point of sambutoxin is predicted to be 591.4±50.0 °C.

What is the density of sambutoxin?

The density of sambutoxin is predicted to be 1.118±0.06 g/cm3.

What is the pKa value of sambutoxin?

The pKa value of sambutoxin is predicted to be 4.50±1.00.

How is sambutoxin produced?

Sambutoxin is produced by toxic Fusarium isolates obtained from rotted potato tubers.

What type of compound is sambutoxin?

Sambutoxin is a terpene glycoside.

How is sambutoxin used?

Sambutoxin is a mycotoxin that is produced by certain Fusarium isolates.

What are some synonyms for sambutoxin?

Some synonyms for sambutoxin may include 2(1H)-Pyridinone, 4-hydroxy-5-(4-hydroxyphenyl)-1-methyl-3-[(2S,5R,6R)-tetrahydro-5-methyl-6-[(1E,3R,5S)-1,3,5-trimethyl-1-hepten-1-yl]-2H-pyran-2-yl].

What is the CAS number for sambutoxin?

The CAS number for sambutoxin is 160047-56-3.

※ Please kindly note that our products are for research use only.