Sanguinine

Sanguinine

Inquiry
Catalog Number ACM60755808-1
CAS Number 60755-80-8
Structure
Synonyms O-Desmethylgalantamine
Molecular Weight 273.33
InChI InChI=1S/C16H19NO3/c1-17-7-6-16-5-4-11(18)8-13(16)20-15-12(19)3-2-10(9-17)14(15)16/h2-5,11,13,18-19H,6-9H2,1H3/t11-,13-,16-/m0/s1
InChI Key OYSGWKOGUVOGFQ-RBOXIYTFSA-N
Melting Point 227-230 °C
Purity 90%+
Complexity 426
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 3
Exact Mass 273.13649347
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 2
Isomeric SMILES CN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)O)O
Monoisotopic Mass 273.13649347
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 52.9 Ų
Custom Q&A

What is the chemical name of the compound with the CAS number 60755-80-8?

The chemical name of the compound is O-DESMETHYLGALANTHAMINE.

What is the molecular formula of O-DESMETHYLGALANTHAMINE?

The molecular formula is C16H19NO3.

What is the melting point of O-DESMETHYLGALANTHAMINE?

The melting point is 227-230°C.

What is the main usage of O-DESMETHYLGALANTHAMINE?

It is a metabolite of Galanthamine, which is a selective acetylcholinesterase inhibitor.

How does Sanguinine differ from Galanthamine in terms of acetylcholinesterase inhibitory activity?

Sanguinine has a more potent acetylcholinesterase inhibitory activity than galanthamine due to an extra hydroxyl group available for potential interaction with acetylcholinesterase.

What is the storage temperature recommended for O-DESMETHYLGALANTHAMINE?

The storage temperature recommended is -20°C freezer.

What is the solubility of O-DESMETHYLGALANTHAMINE in DMSO?

It is soluble in DMSO.

What is the predicted pKa of O-DESMETHYLGALANTHAMINE?

The predicted pKa is 9.39±0.40.

What is the chemical property of Sanguinine?

Sanguinine is a pale yellow powder.

How does the acetylcholinesterase inhibitory activity of Sanguinine compare to that of lycoramine and epinorlicoramine?

Sanguinine is 10-fold more selective than galanthamine for acetylcholinesterase (AChE) vs. butyrylcholinesterase (BuChE), whereas lycoramine and epinorlicoramine lack AChE inhibitory activity.

※ Please kindly note that our products are for research use only.