Sarranicine

Catalog Number	ACM136173256
CAS Number	136173-25-6
Molecular Weight	337.4
InChI	InChI=1S/C18H27NO5/c1-4-12(3)17(21)24-15-7-9-19-8-6-14(16(15)19)11-23-18(22)13(5-2)10-20/h4-5,14-16,20H,6-11H2,1-3H3/b12-4+,13-5-/t14-,15-,16-/m1/s1
InChI Key	YMUQRQKYYOWGPN-MBQDPZAHSA-N
Purity	95%+
Complexity	540
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	337.18892296
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(\C)/C(=O)O[C@@H]1CCN2[C@@H]1[C@H](CC2)COC(=O)/C(=C\C)/CO
Monoisotopic Mass	337.18892296
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical formula for Sarranicine?

The chemical formula for Sarranicine is C18H27NO5.

What is the molecular weight of Sarranicine?

The molecular weight of Sarranicine is 337.41.

What are some synonyms for Sarranicine?

Some synonyms for Sarranicine include 2-Butenoic acid, 2-(hydroxymethyl)-, and [(1S,7R,7aR)-hexahydro-7-[[(2E)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-1-yl]methyl ester.

What is the CAS number for Sarranicine?

The CAS number for Sarranicine is 136173-25-6.

How many carbon atoms are in the molecular structure of Sarranicine?

There are 18 carbon atoms in the molecular structure of Sarranicine.

What is the name of the compound that contains Sarranicine?

Sarranicine is a compound that contains 2-Butenoic acid and (2Z)-2-(hydroxymethyl)-, [(1S,7R,7aR)-hexahydro-7-[[(2E)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-1-yl]methyl ester.

What is the stereochemistry of Sarranicine?

The stereochemistry of Sarranicine is specified as (1S,7R,7aR) in its chemical structure.

What functional groups are present in the molecular structure of Sarranicine?

Sarranicine contains functional groups such as hydroxymethyl, ester, and oxo groups in its molecular structure.

※ Please kindly note that our products are for research use only.