Schizanthine A

Catalog Number	ACM70474247
CAS Number	70474-24-7
Synonyms	(E)-2-Methyl-2-butenedioic acid 4-ethyl 1-[(1R,1α,5S)-8-methyl-6α-[(3-methyl-1-oxo-2-butenyl)oxy]-8-azabicyclo[3.2.1]octan-3β-yl] ester
Molecular Weight	379.4
InChI	InChI=1S/C20H29NO6/c1-6-25-18(22)8-13(4)20(24)26-15-9-14-10-17(16(11-15)21(14)5)27-19(23)7-12(2)3/h7-8,14-17H,6,9-11H2,1-5H3/b13-8+/t14-,15-,16+,17-/m1/s1
InChI Key	LTHNNGQCWYQQLA-QYMHLLFHSA-N
Purity	95%+
Complexity	649
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	379.19948764
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CCOC(=O)/C=C(\C)/C(=O)O[C@@H]1C[C@@H]2C[C@H]([C@H](C1)N2C)OC(=O)C=C(C)C
Monoisotopic Mass	379.19948764
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	82.1 Ų

Custom Q&A

What is the chemical name of the compound known as Schizanthine A?

(E)-2-Methyl-2-butenedioic acid 4-ethyl 1-[(1R,1α,5S)-8-methyl-6α-[(3-methyl-1-oxo-2-butenyl)oxy]-8-azabicyclo[3.2.1]octan-3β-yl] ester

What are some synonyms for Schizanthine A?

2-Butenedioic acid, 2-methyl-, 4-ethyl 1-[(1R,3R,5S,6R)-8-methyl-6-[(3-methyl-1-oxo-2-buten-1-yl)oxy]-8-azabicyclo[3.2.1]oct-3-yl] ester, (2E-)

What is the CAS number of Schizanthine A?

70474-24-7

What is the molecular formula of Schizanthine A?

C20H29NO6

What is the molecular weight of Schizanthine A?

379.45

What is the structure of Schizanthine A?

(E)-2-Methyl-2-butenedioic acid 4-ethyl 1-[(1R,1α,5S)-8-methyl-6α-[(3-methyl-1-oxo-2-butenyl)oxy]-8-azabicyclo[3.2.1]octan-3β-yl] ester

※ Please kindly note that our products are for research use only.